Name |
Delphinidin 3-arabinoside Delphinidin-3-O-arabinoside |
Formula |
C20H19O11 |
Mw |
435.09273645 |
CAS RN |
28500-01-8 |
C_ID |
C00006696
,
|
InChIKey |
XZUBZVMZVWFBNE-CRJFCAEUNA-O |
InChICode |
InChI=1S/C20H18O11/c21-8-3-10(22)9-5-15(31-20-18(28)17(27)13(25)6-29-20)19(30-14(9)4-8)7-1-11(23)16(26)12(24)2-7/h1-5,13,17-18,20,25,27-28H,6H2,(H4-,21,22,23,24,26)/p+1/t13-,17+,18-,20-/m0/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@H]([C@@H]([C@H](CO1)O)O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Carthamus glauca | Ref. |
Plantae | Ericaceae | Acrotriche serrulata | Ref. |
Plantae | Ericaceae | Empetrum nigrum | Ref. |
Plantae | Ericaceae | Epacris gunnii | Ref. |
Plantae | Ericaceae | Leucopogon collinus | Ref. |
Plantae | Ericaceae | Pentachondra ericaefolia | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Ericaceae | Trochocarpa spp. | Ref. |
Plantae | Ericaceae | Vaccinium angustifolium | Ref. |
Plantae | Ericaceae | Vaccinium arboreum | Ref. |
Plantae | Ericaceae | Vaccinium padifolium | Ref. |
Plantae | Ericaceae | Vaccinium spp. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
|
|
zoom in
Organism | Pentachondra ericaefolia | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Francis,J.Food Sci.,31,(1966),583
Jarman,Phytochem.,10,(1971),2235 |
---|
|