Name |
Peonidin-3,5-diglucoside Peonin Peonidin 3,5-diglucoside Peonidin 3-glucoside-5-glucoside |
Formula |
C28H33O16 |
Mw |
625.17686001 |
CAS RN |
132-37-6 |
C_ID |
C00006688
, 
|
InChIKey |
IPVSUYLZIAYTOK-NGAYGKTRNA-O |
InChICode |
InChI=1S/C28H32O16/c1-39-16-4-10(2-3-13(16)32)26-17(42-28-25(38)23(36)21(34)19(9-30)44-28)7-12-14(40-26)5-11(31)6-15(12)41-27-24(37)22(35)20(33)18(8-29)43-27/h2-7,18-25,27-30,33-38H,8-9H2,1H3,(H-,31,32)/p+1/t18-,19+,20+,21+,22-,23-,24+,25+,27+,28+/m0/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)OC)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica  | Ref. |
Plantae | Bromeliaceae | Ananas comosus  | Ref. |
Plantae | Bromeliaceae | Tillandsia spp. | Ref. |
Plantae | Combretaceae | Lumnitzera littorea | Ref. |
Plantae | Convolvulaceae | Ipomoea nil  | Ref. |
Plantae | Dioscoreaceae | Dioscorea trifida  | Ref. |
Plantae | Dioscoreaceae | Dioscorea tryphida | Ref. |
Plantae | Ericaceae | Rhododendron simsii | Ref. |
Plantae | Geraniaceae | Pelargonium sp.  | Ref. |
Plantae | Iridaceae | Gladiolus spp. | Ref. |
Plantae | Labiatae | Prunella vulgaris  | Ref. |
Plantae | Magnoliaceae | Magnolia spp. | Ref. |
Plantae | Myrtaceae | Beaufortia squarrosa | Ref. |
Plantae | Onagraceae | Fuchsia hybrida | Ref. |
Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
Plantae | Paeoniaceae | Paeonia spp. | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
Organism | Vitis vinifera | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann.,408,(1915),136
Francis,Proc.Am.Soc.Hortic.Sci.,89,(1966),657 |
---|
|