Name |
Cyanidin 3-O-beta-D-galactopyranoside Idaein Cyanidin 3-galactoside Cyanidin 3-O-galactoside |
Formula |
C21H21O11 |
Mw |
449.10838652 |
CAS RN |
27661-36-5 |
C_ID |
C00006652
,
|
InChIKey |
RKWHWFONKJEUEF-PNSIFLDANA-O |
InChICode |
InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p+1/t16-,17+,18+,19-,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(c(c2)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Pistacia vera | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Asparagaceae | Asparagus racemosus | Ref. |
Plantae | Celastraceae | Euonymus europaea | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus mas | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus suecica | Ref. |
Plantae | Ericaceae | Arbutus unedo | Ref. |
Plantae | Ericaceae | Gaylussacia spp. | Ref. |
Plantae | Ericaceae | Vaccinium arboreum Marsh. | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus L. | Ref. |
Plantae | Ericaceae | Vaccinium padifolium | Ref. |
Plantae | Ericaceae | Vaccinium spp. | Ref. |
Plantae | Ericaceae | Vaccinium vitis-idaea | Ref. |
Plantae | Euphorbiaceae | Acalypha hispida | Ref. |
Plantae | Fagaceae | Fagus sylvatica | Ref. |
Plantae | Hippuridaceae | Hippuris vulgaris | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Theobroma cacao | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Nymphaeaceae | Nymphaea candida | Ref. |
Plantae | Plumbaginaceae | Ceratostigma plumbaginoides | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Rosaceae | Amelanchier turkestanica | Ref. |
Plantae | Rosaceae | Chaenomeles speciosa | Ref. |
Plantae | Rosaceae | Malus sylvestris | Ref. |
Plantae | Rosaceae | Pyrus communis | Ref. |
Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
Plantae | Ternstroemiaceae | Visnea mocanera | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Theaceae | Camellia spp. | Ref. |
|
|
zoom in
Organism | Amelanchier turkestanica | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann,408,(1915),15
Timberlake,J.Sci.Food Agric.,22,(1971),509 |
---|
|