Name |
Luteolinidin 5-glucoside Luteolinidin-5-glucoside |
Formula |
C21H21O10 |
Mw |
433.11347189 |
CAS RN |
13089-93-5 |
C_ID |
C00006623
,
|
InChIKey |
RXQNESSHTIRLBK-MHDJWYLPNA-O |
InChICode |
InChI=1S/C21H20O10/c22-8-17-18(26)19(27)20(28)21(31-17)30-16-7-10(23)6-15-11(16)2-4-14(29-15)9-1-3-12(24)13(25)5-9/h1-7,17-22,26-28H,8H2,(H2-,23,24,25)/p+1/t17-,18-,19+,20-,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)[o+]c(cc2)c1ccc(c(c1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Azollaceae | Azolla filiculoides | Ref. |
Plantae | Azollaceae | Azolla imbricata | Ref. |
Plantae | Azollaceae | Azolla mexicana | Ref. |
Plantae | Blechnaceae | Blechnum procerum | Ref. |
Plantae | Gesneriaceae | Alloplectus vittatus | Ref. |
Plantae | Gesneriaceae | Chrysothemis pulchella | Ref. |
Plantae | Gesneriaceae | Hypocyrta glabra | Ref. |
Plantae | Gesneriaceae | Kohleria eriantha | Ref. |
Plantae | Gesneriaceae | Rechsteineria macrorhiza | Ref. |
Plantae | Poaceae | Sorghum vulgare | Ref. |
Plantae | Pteridaceae | Adiantum pedatum | Ref. |
Plantae | Pteridaceae | Adiantum veitchianum | Ref. |
Plantae | Pteridaceae | Pteris spp. | Ref. |
- | - | Bryum spp. | Ref. |
|
|
zoom in
Organism | Azolla mexicana | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Bendz,Acta Chem.Scand.,16,(1962),1183
Harborne,Phytochem.,5,(1966),589 |
---|
|