Name |
Isoschaftoside Apigenin 6-C-alpha-L-arabinopyranoside-8-C-beta-D-glucopyranoside Isoshaftoside |
Formula |
C26H28O14 |
Mw |
564.14790561 |
CAS RN |
52012-29-0 |
C_ID |
C00006381
,
|
InChIKey |
OVMFOVNOXASTPA-WCGZTJJSNA-N |
InChICode |
InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)16-20(34)15(25-22(36)17(31)11(30)7-38-25)19(33)14-10(29)5-12(39-24(14)16)8-1-3-9(28)4-2-8/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18+,21-,22-,23+,25-,26-/m0/s1 |
SMILES |
c1(c(c(c2c(c1[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@H]([C@H]([C@H](CO1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Araceae | Colocasia esculenta | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Asteraceae | Artemisia consanguineum | Ref. |
Plantae | Asteraceae | Artemisia heterophyllum | Ref. |
Plantae | Asteraceae | Artemisia spp. | Ref. |
Plantae | Asteraceae | Baccharis gaudichaudiana DC | Ref. |
Plantae | Asteraceae | Catananche caerulea | Ref. |
Plantae | Asteraceae | Flourensia cernua | Ref. |
Plantae | Caryophyllaceae | Stellaria media | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Poaceae | Arrhenatherum spp. | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Rosaceae | Crataegus monogyna L. | Ref. |
Plantae | Rosaceae | Cydonia oblonga | Ref. |
Plantae | Solanaceae | Capsicum annum L. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE | Ref. |
Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
Organism | Glycyrrhiza inflata | Reference | Takagi, et al., Phytochemistry, 20, (1981), 2443.
Xing, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 593.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
---|
|