Name |
Vicenin Vicenin 2 Vicenin II Apigenin 6,8-di-C-glucoside Vicenin-2 |
Formula |
C27H30O15 |
Mw |
594.15847029 |
CAS RN |
23666-13-9 |
C_ID |
C00006229
,
|
InChIKey |
FIAAVMJLAGNUKW-ZYYYSNSLNA-N |
InChICode |
InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2/t12-,13-,17+,18+,21-,22-,23+,24-,26-,27-/m0/s1 |
SMILES |
c1(c(c(c2c(c1[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Cirsium oligophyllum | Ref. |
Plantae | Asteraceae | Eupatorium serotinum | Ref. |
Plantae | Asteraceae | Tragopogon spp. | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Caryophyllaceae | Spergularia rubra | Ref. |
Plantae | Caryophyllaceae | Stellaria media | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
Plantae | Ephedraceae | Ephedra aphylla | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Sophora spp. | Ref. |
Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Labiatae | Ballota foetida | Ref. |
Plantae | Labiatae | Meehania urticifolia | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Salvia lanigera | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia spinosa | Ref. |
Plantae | Labiatae | Salvia triloba | Ref. |
Plantae | Labiatae | Stachys officinalis (L.) Trev. | Ref. |
Plantae | Labiatae | Teucridium parvifolium | Ref. |
Plantae | Labiatae | Thymus membranaceus | Ref. |
Plantae | Labiatae | Tripora divaricata | Ref. |
Plantae | Labiatae | Vitex lucens | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Petrosaviaceae/Nartheciaceae | Japonolirion osense | Ref. |
Plantae | Poaceae | Triticum aestivum | Ref. |
Plantae | Rosaceae | Cydonia oblonga | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus unshiu | Ref. |
Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Violaceae | Viola tricolor | Ref. |
Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
Organism | Moringa oleifera | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|