Name |
Saponarin |
Formula |
C27H30O15 |
Mw |
594.15847029 |
CAS RN |
20310-89-8 |
C_ID |
C00006224
,
|
InChIKey |
HGUVPEBGCAVWID-ALWFZJRANA-N |
InChICode |
InChI=1S/C27H30O15/c28-7-15-19(32)22(35)24(37)26(40-15)18-14(41-27-25(38)23(36)20(33)16(8-29)42-27)6-13-17(21(18)34)11(31)5-12(39-13)9-1-3-10(30)4-2-9/h1-6,15-16,19-20,22-30,32-38H,7-8H2/t15-,16-,19-,20-,22+,23+,24-,25-,26+,27-/m1/s1 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Caryophyllaceae | Saponaria officinalis | Ref. |
Plantae | Cucurbitaceae | Bryonia dioica | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Fabaceae | Lespedeza juncea | Ref. |
Plantae | Gentianaceae | Gentiana algida | Ref. |
Plantae | Gentianaceae | Gentiana decumbens | Ref. |
Plantae | Gentianaceae | Gentiana decumbers | Ref. |
Plantae | Gentianaceae | Gentiana macrophylla | Ref. |
Plantae | Gentianaceae | Gentiana piasezkii | Ref. |
Plantae | Gentianaceae | Gentiana triflora | Ref. |
Plantae | Malvaceae | Hibiscus syriacus | Ref. |
Plantae | Passifloraceae | Passiflora incarnata | Ref. |
Plantae | Poaceae | Arrhenatherum sp. | Ref. |
- | - | Mnium cuspidatum | Ref. |
|
|
zoom in
Organism | Gentiana piasezkii | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|