Name |
Schaftoside Shaftoside |
Formula |
C26H28O14 |
Mw |
564.14790561 |
CAS RN |
51938-32-0 |
C_ID |
C00006177
,
|
InChIKey |
MMDUKUSNQNWVET-WCGZTJJSNA-N |
InChICode |
InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17-,18-,21+,22+,23-,25-,26+/m1/s1 |
SMILES |
c1(c(c(c2c(c1[C@@H]1[C@H]([C@@H]([C@@H](CO1)O)O)O)oc(cc2=O)c1ccc(cc1)O)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
Plantae | Apiaceae | Astrantia major | Ref. |
Plantae | Araceae | Arisaema consanguineum | Ref. |
Plantae | Araceae | Arisaema heterophyllum | Ref. |
Plantae | Araceae | Colocasia esculenta | Ref. |
Plantae | Araceae | Colocasia escultenta | Ref. |
Plantae | Asteraceae | Catananche caerulea | Ref. |
Plantae | Asteraceae | Centaurea hierapolitana | Ref. |
Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
Plantae | Asteraceae | Centaurea solstitialis | Ref. |
Plantae | Caryophyllaceae | Silene schafta | Ref. |
Plantae | Caryophyllaceae | Stellaria holostea | Ref. |
Plantae | Caryophyllaceae | Stellaria media | Ref. |
Plantae | Caryophyllaceae | Stellaria nemorum | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis | Ref. |
Plantae | Fabaceae | Lespedeza capitata | Ref. |
Plantae | Labiatae | Meehania urticifolia | Ref. |
Plantae | Labiatae | Salvia blepharophylla | Ref. |
Plantae | Metzgeriaceae | Metzgeria furcata | Ref. |
Plantae | Poaceae | Dactylis glomerata | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Rosaceae | Crataegus monogyna L. | Ref. |
Plantae | Rosaceae | Cydonia oblonga | Ref. |
Plantae | Solanaceae | Capsicum annum L. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
Organism | Stellaria holostea | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|