Name |
Myricetin 3-O-galactopyranoside Myricetin 3-O-galactoside Myricetin 3-galactoside Myricetin-3-O-beta-D-galactopyranoside |
Formula |
C21H20O13 |
Mw |
480.09039073 |
CAS RN |
15648-86-9 |
C_ID |
C00005728
,
|
InChIKey |
FOHXFLPXBUAOJM-NSFXHULNNA-N |
InChICode |
InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15+,17+,18-,21+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Lycaenidae | Polyommatus icarus | Ref. |
Plantae | Asteraceae | Haplopappus bailahuen | Ref. |
Plantae | Bromeliaceae | Portea petropolitana | Ref. |
Plantae | Dioscoreaceae | Dioscorea bulbifera | Ref. |
Plantae | Fabaceae | Acacia latifolia | Ref. |
Plantae | Fabaceae | Trifolium pannonicum | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Iridaceae | Patersonia spp. | Ref. |
Plantae | Myricaceae | Myrica gale | Ref. |
Plantae | Myrtaceae | Luma chequen | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Onagraceae | Oenothera lavendulaefolia | Ref. |
Plantae | Plumbaginaceae | Limonium latifolium | Ref. |
Plantae | Plumbaginaceae | Limonium serbicum | Ref. |
Plantae | Polygonaceae | Eriogonum nudum | Ref. |
Plantae | Restionaceae | Chondropetalum spp. | Ref. |
Plantae | Restionaceae | Elegia spp. | Ref. |
Plantae | Salicaceae | Populus candicans | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Theaceae | Thea sinensis | Ref. |
|
|
zoom in
Organism | Oenothera lavendulaefolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Takino,Tetrahedron Lett.,(1965),4019
Kagan,Phytochem.,6,(1967),317 |
---|
|