Name |
Isorhamnetin 3,7-di-O-beta-glucopyranoside Isorhamnetin 3,7-diglucoside Isorhamnetin 3,7-di-beta-D-glucopyranoside |
Formula |
C28H32O17 |
Mw |
640.1639496 |
CAS RN |
6758-51-6 |
C_ID |
C00005556
,
|
InChIKey |
ZYYJHXKSQKLEBL-PIHYUUDINA-N |
InChICode |
InChI=1S/C28H32O17/c1-40-13-4-9(2-3-11(13)31)25-26(45-28-24(39)22(37)19(34)16(8-30)44-28)20(35)17-12(32)5-10(6-14(17)42-25)41-27-23(38)21(36)18(33)15(7-29)43-27/h2-6,15-16,18-19,21-24,27-34,36-39H,7-8H2,1H3/t15-,16-,18-,19-,21+,22+,23-,24+,27-,28+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)OC)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Crassulaceae | Sedum acre | Ref. |
Plantae | Crassulaceae | Sedum alfredi | Ref. |
Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
Plantae | Cruciferae | Brassica juncea | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cruciferae | Sinapis arvensis | Ref. |
Plantae | Fabaceae | Astragalus galegiformis | Ref. |
Plantae | Fabaceae | Lotus polyphyllos | Ref. |
Plantae | Papaveraceae | Argemone mexicana | Ref. |
Plantae | Solanaceae | Solanum spp. | Ref. |
Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
|
|
zoom in
Organism | Sedum acre | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Krishnamurti,Indian J.Chem.,3,(1965),270
Horhammer,Tetrahydron Lett.,(1966),567 |
---|
|