Name |
Hyperin Quercetin-3-beta-galactoside Quercetin 3-galactoside Hyperoside Quercetin 3-O-beta-D-galactopyranoside Quercetin 3-O-beta-D-galactoside Quercetin 3-O-galactoside Quercetin 3-beta-galactopyranoside |
Formula |
C21H20O12 |
Mw |
464.09547611 |
CAS RN |
482-36-0 |
C_ID |
C00005372
,
|
InChIKey |
OVSQVDMCBVZWGM-WPPCZBDQNA-N |
InChICode |
InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17-,18+,21+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@H]([C@@H]([C@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Lycaenidae | Polyommatus icarus | Ref. |
Chromalveolata | Lessoniaceae | Ecklonia cava | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Alliaceae | Allium sativum | Ref. |
Plantae | Alliaceae | Allium Sativum | Ref. |
Plantae | Amaryllidaceae | Galanthus caucasicus | Ref. |
Plantae | Amaryllidaceae | Lycoris radiata | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Rhus wallichi | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apocynaceae | Amsonia ciliata | Ref. |
Plantae | Apocynaceae | Apocynum venetum | Ref. |
Plantae | Araliaceae | Kalopanax septemlobus | Ref. |
Plantae | Asparagaceae | Asparagus racemosus | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Asanthus thyrsiflora | Ref. |
Plantae | Asteraceae | Clibadium spp. | Ref. |
Plantae | Asteraceae | Desmanthodium spp. | Ref. |
Plantae | Asteraceae | Eupatorium lindleyanum | Ref. |
Plantae | Asteraceae | Gutierrezia grandis | Ref. |
Plantae | Asteraceae | Haplopappus foliosus | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Senecio cymosus | Ref. |
Plantae | Asteraceae | Senecio otiles | Ref. |
Plantae | Asteraceae | Senecio yegua | Ref. |
Plantae | Asteraceae | Tussilago farfara | Ref. |
Plantae | Berberidaceae | Epimedium brevicornum | Ref. |
Plantae | Berberidaceae | Epimedium koreanum | Ref. |
Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
Plantae | Betulaceae | Betula middendorfii | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Celastraceae | Euonymus sacrosancta | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Convallariaceae | Convallaria keiskei | Ref. |
Plantae | Convolvulaceae | Cuscuta chinensis | Ref. |
Plantae | Cornaceae | Camptotheca acuminata | Ref. |
Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cunoniaceae | Eucryphia spp. | Ref. |
Plantae | Dipsacaceae | Cephalaria kotschyi | Ref. |
Plantae | Dipsacaceae | Cephalaria nachiczevanica | Ref. |
Plantae | Ericaceae | Pyrola atropurpurea | Ref. |
Plantae | Ericaceae | Pyrola calliantha | Ref. |
Plantae | Ericaceae | Pyrola decorata | Ref. |
Plantae | Ericaceae | Pyrola elliptica | Ref. |
Plantae | Ericaceae | Pyrola japonica | Ref. |
Plantae | Ericaceae | Rhododendron anthopogonoides | Ref. |
Plantae | Ericaceae | Rhododendron dauricum | Ref. |
Plantae | Ericaceae | Rhododendron ferrugineum | Ref. |
Plantae | Ericaceae | Rhododendron micranthum | Ref. |
Plantae | Euphorbiaceae | Croton tonkinensis GAGNEP | Ref. |
Plantae | Euphorbiaceae | Euphorbia lunulata | Ref. |
Plantae | Fabaceae | Acacia melanoxylon | Ref. |
Plantae | Fabaceae | Acacia praecox | Ref. |
Plantae | Fabaceae | Anthyllis onobrychioides | Ref. |
Plantae | Fabaceae | Astragalus brachycarpus | Ref. |
Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
Plantae | Fabaceae | Hedysarum sericeum | Ref. |
Plantae | Fabaceae | Lathyrus chrysanthus | Ref. |
Plantae | Fabaceae | Lotus corniculatus | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Fabaceae | Onobrychis bobrovi | Ref. |
Plantae | Fabaceae | Onobrychis vassiltschenkoi | Ref. |
Plantae | Fabaceae | Ononis leiosperma | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Tachigalia paniculata | Ref. |
Plantae | Fabaceae | Trifolium montanum | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens L. | Ref. |
Plantae | Fumariaceae | Fumaria capreolata | Ref. |
Plantae | Fumariaceae | Fumaria officinalis | Ref. |
Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
Plantae | Fumariaceae | Fumaria vaillantii | Ref. |
Plantae | Geraniaceae | Geranium niveum | Ref. |
Plantae | Geraniaceae | Geranium wilfordii | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hypericaceae | Cratoxylum formosum ssp.pruniflorum | Ref. |
Plantae | Hypericaceae | Hypericum ascyron | Ref. |
Plantae | Hypericaceae | Hypericum barbatum Jacq. | Ref. |
Plantae | Hypericaceae | Hypericum curvisepalum | Ref. |
Plantae | Hypericaceae | Hypericum elodioides | Ref. |
Plantae | Hypericaceae | Hypericum faberi | Ref. |
Plantae | Hypericaceae | Hypericum forrestii | Ref. |
Plantae | Hypericaceae | Hypericum hirsutum L. | Ref. |
Plantae | Hypericaceae | Hypericum japonicum | Ref. |
Plantae | Hypericaceae | Hypericum lancasteri | Ref. |
Plantae | Hypericaceae | Hypericum linarioides BOSSE | Ref. |
Plantae | Hypericaceae | Hypericum maculatum Crantz | Ref. |
Plantae | Hypericaceae | Hypericum patulum | Ref. |
Plantae | Hypericaceae | Hypericum perforatum | Ref. |
Plantae | Hypericaceae | Hypericum rumeliacum BOISS. | Ref. |
Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
Plantae | Hypericaceae | Hypericum scabrum | Ref. |
Plantae | Hypericaceae | Hypericum subsessile | Ref. |
Plantae | Hypericaceae | Hypericum tetrapterum Fries | Ref. |
Plantae | Hypericaceae | Hypericum wightianum subsp.axillare | Ref. |
Plantae | Iridaceae | Patersonia spp. | Ref. |
Plantae | Labiatae | Prunella vulgaris | Ref. |
Plantae | Lauraceae | Cassytha filiformis | Ref. |
Plantae | Lauraceae | Lindera obtusiloba | Ref. |
Plantae | Longaniaceae | Strychnos spinosa | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Abelmoschus manihot | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Menyanthaceae | Menyanthes trifoliata L. | Ref. |
Plantae | Musaceae | Musa acuminata | Ref. |
Plantae | Myrsinaceae | Lysimachia mauritiana | Ref. |
Plantae | Myrtaceae | Eucalyptus globulus | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Nelumbonaceae | Nelumbo nucifera | Ref. |
Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
Plantae | Pinaceae | Abies amabilis | Ref. |
Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
Plantae | Polygonaceae | Polygonum salicifolium | Ref. |
Plantae | Polygonaceae | Rumex aquaticus | Ref. |
Plantae | Primulaceae | Primula veris | Ref. |
Plantae | Pteridaceae | Adiantum monochlamys | Ref. |
Plantae | Restionaceae | Cannomois virgata | Ref. |
Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
Plantae | Rosaceae | Agrimonia pilosa | Ref. |
Plantae | Rosaceae | Agrimonia pilosa var.japonica | Ref. |
Plantae | Rosaceae | Crataegus cuneata | Ref. |
Plantae | Rosaceae | Crataegus hupehensis | Ref. |
Plantae | Rosaceae | Crataegus kansuensis | Ref. |
Plantae | Rosaceae | Crataegus maximowiczii | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.major | Ref. |
Plantae | Rosaceae | Crataegus pinnatifida var.psilosa | Ref. |
Plantae | Rosaceae | Crataegus sanguinea | Ref. |
Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
Plantae | Rosaceae | Parageum montanum | Ref. |
Plantae | Rosaceae | Rosa luciae | Ref. |
Plantae | Rosaceae | Rosa multiflora | Ref. |
Plantae | Rosaceae | Sanguisorba officinalis | Ref. |
Plantae | Rosaceae | Spiraea formosana | Ref. |
Plantae | Rubiaceae | Adina racemosa | Ref. |
Plantae | Rubiaceae | Cruciata taurica | Ref. |
Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
Plantae | Rubiaceae | Uncaria hirsuta | Ref. |
Plantae | Rubiaceae | Uncaria rhynchophyllus | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Rutaceae | Zanthoxylum bungeanum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Saururus chinensis | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Saxifragaceae | Saxifraga stellaris | Ref. |
Plantae | Taxodiaceae | Taxodium distichum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Urticaceae | Boehmeria holosericea | Ref. |
Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
- | - | Aceraceae negundo | Ref. |
- | - | Aganosma caryophyllata | Ref. |
- | - | Chamaenerion angustifolium | Ref. |
- | - | Monochaetun multiflorum | Ref. |
- | - | Oxycoccus quadripetalis | Ref. |
|
|
zoom in
Organism | Taxodium distichum | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Jerzmanowska,Widomssci Farmac.,64,(1937),527 |
---|
|