Name |
Avicularin Avicularine Avicularoside Quercetin 3-alpha-L-arabinofuranoside Quercetin 3-O-alpha-L-arabinofuranoside |
Formula |
C20H18O11 |
Mw |
434.08491142 |
CAS RN |
572-30-5 |
C_ID |
C00005367
,
|
InChIKey |
BDCDNTVZSILEOY-UYJXXPCPNA-N |
InChICode |
InChI=1S/C20H18O11/c21-6-13-15(26)17(28)20(30-13)31-19-16(27)14-11(25)4-8(22)5-12(14)29-18(19)7-1-2-9(23)10(24)3-7/h1-5,13,15,17,20-26,28H,6H2/t13-,15+,17+,20-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@@H](O1)CO)O)O)c1ccc(c(c1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Ericaceae | Arctostaphylos uva-ursi | Ref. |
Plantae | Ericaceae | Ledum palustre | Ref. |
Plantae | Ericaceae | Richea angustifolia | Ref. |
Plantae | Ericaceae | Richea scoparia | Ref. |
Plantae | Ericaceae | Vaccinium myritillus | Ref. |
Plantae | Ericaceae | Vaccinium myrtillus | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hypericaceae | Hypericum scabrum | Ref. |
Plantae | Juglandaceae | Juglans regia | Ref. |
Plantae | Myrtaceae | Pimenta dioica | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Polygonaceae | Polygonum aviculare | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
Plantae | Rosaceae | Chaenomeles sinensis KOEHNE | Ref. |
Plantae | Rosaceae | Cowania mexicana | Ref. |
Plantae | Rosaceae | Dryas octopetala | Ref. |
Plantae | Solanaceae | Solanum glaucophyllum | Ref. |
Plantae | Taxodiaceae | Taxodium distichum | Ref. |
- | - | Tapirira guianensis | Ref. |
|
|
zoom in
Organism | Richea angustifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Ice,J.Am.Chem.Soc.,75,(1953),50
Geiger,Phytochem.,18,(1979),1709 |
---|
|