Name |
Kaempferitrin Kaempferol 3,7-di-O-rhamnoside Kaempferol 3,7-di-O-alpha-rhamnopyranoside Kaempferol 3,7-dirhamnoside |
Formula |
C27H30O14 |
Mw |
578.16355567 |
CAS RN |
482-38-2 |
C_ID |
C00005189
,
|
InChIKey |
PUPKKEQDLNREIM-SIHGUETHNA-N |
InChICode |
InChI=1S/C27H30O14/c1-9-17(30)20(33)22(35)26(37-9)39-13-7-14(29)16-15(8-13)40-24(11-3-5-12(28)6-4-11)25(19(16)32)41-27-23(36)21(34)18(31)10(2)38-27/h3-10,17-18,20-23,26-31,33-36H,1-2H3/t9-,10-,17-,18-,20-,21+,22-,23-,26-,27-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)C)c1ccc(cc1)O)O)O[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Apiaceae | Eryngium planum | Ref. |
Plantae | Aspleniaceae | Asplenium bulbiferum | Ref. |
Plantae | Aspleniaceae | Asplenium trichomanes | Ref. |
Plantae | Asteraceae | Clibadium pilonicum | Ref. |
Plantae | Asteraceae | Clibadium surinamense | Ref. |
Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
Plantae | Asteraceae | Liatris spp. | Ref. |
Plantae | Asteraceae | Tagetes erecta | Ref. |
Plantae | Berberidaceae | Epimedium acuminatum | Ref. |
Plantae | Berberidaceae | Epimedium brevicornum | Ref. |
Plantae | Berberidaceae | Epimedium sutchuenense | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Celastraceae | Celastrus hypoleucus | Ref. |
Plantae | Chenopodiaceae | Chenopodium murale | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Crassulaceae | Sedum telephium | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Raphanus sativus | Ref. |
Plantae | Cucurbitaceae | Siraitia grosvenori | Ref. |
Plantae | Cucurbitaceae | Trichosanthes cucumeroides | Ref. |
Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
Plantae | Erythroxylaceae | Erythroxylum cuneifolium | Ref. |
Plantae | Fabaceae | Acacia mangium | Ref. |
Plantae | Fabaceae | Desmodium podocarpum | Ref. |
Plantae | Fabaceae | Desmodium racemosum | Ref. |
Plantae | Fabaceae | Dorycnium graecum | Ref. |
Plantae | Fabaceae | Dorycnium pentaphyllum | Ref. |
Plantae | Fabaceae | Indigofera arrecta | Ref. |
Plantae | Fabaceae | Lathyrus spp. | Ref. |
Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
Plantae | Fabaceae | Lotus corniculatus | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Geraniaceae | Geranium nepalense | Ref. |
Plantae | Hymenophytaceae | Hymenophyton leptopodum | Ref. |
Plantae | Lauraceae | Cinnamomum sieboldii | Ref. |
Plantae | Malvaceae | Hibiscus cannabinus | Ref. |
Plantae | Malvaceae | Tilia alburnum | Ref. |
Plantae | Moraceae | Ficus septica | Ref. |
Plantae | Myrsinaceae | Ardisia colorata | Ref. |
Plantae | Myrsinaceae | Lysimachia christinae | Ref. |
Plantae | Oleaceae | Ligustrum nilghirense | Ref. |
Plantae | Piperaceae | Piper umbellatum | Ref. |
Plantae | Rosaceae | Prunus japonica | Ref. |
Plantae | Solanaceae | Solanum laciniatum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
|
|
zoom in
Organism | Indigofera arrecta | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Perkin,J.Chem.Soc.,91,(1907),435
Hattori,Proc.Imp.Acad.(Tokyo),16,(1940),9 |
---|
|