Name |
Kaempferol 3-glucoside-7-rhamnoside Kaempferol-3-beta-D-gluco-7-alpha-L-rhamnoside Kaempferol-3-beta-D-gluco-7-beta-L-rhamnoside |
Formula |
C27H30O15 |
Mw |
594.15847029 |
CAS RN |
2392-95-2 |
C_ID |
C00005184
,
|
InChIKey |
JYXSWDCPHRTYGU-GHJHJMDPNA-N |
InChICode |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(38-9)39-12-6-13(30)16-14(7-12)40-24(10-2-4-11(29)5-3-10)25(19(16)33)42-27-23(37)21(35)18(32)15(8-28)41-27/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20-,21+,22+,23-,26-,27-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@H]([C@@H]([C@H](O)[C@H](O1)CO)O)O)c1ccc(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Aspleniaceae | Asplenium bulbiferum | Ref. |
Plantae | Aspleniaceae | Asplenium trichomanes-ramosum | Ref. |
Plantae | Asteraceae | Centipeda orbicularis | Ref. |
Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
Plantae | Celastraceae | Celastrus orbiculatus | Ref. |
Plantae | Celastraceae | Euonymus japonicus | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Marah oreganus | Ref. |
Plantae | Elaeagnaceae | Shepherdia argentea | Ref. |
Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
Plantae | Equisetaceae | Equisetum telmateja | Ref. |
Plantae | Fabaceae | Coronilla emerus | Ref. |
Plantae | Fabaceae | Lathyrus sativus | Ref. |
Plantae | Fabaceae | Vicia faba | Ref. |
Plantae | Fabaceae | Vigna spp. | Ref. |
Plantae | Hymenophytaceae | Hymenophyton leptopodum | Ref. |
Plantae | Malvaceae | Tilia argentea | Ref. |
Plantae | Ranunculaceae | Delphinium formosum | Ref. |
|
|
zoom in
Organism | Equisetum telmateja | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Horhammer,Arch.Pharm.(Berl.),294,(1961),685 |
---|
|