Name |
Kaempferol 3-rutinoside Nicotiflorin Nicotifloroside Kaempferol 3-O-rutinoside Kaempferol 3-O-(alpha-L-rhamnopyranosyl(1->6)-beta-D-glucopyranoside (-)-Kaempferol 3-O-(alpha-L-rhamnopyranosyl(1->6)-beta-D-glucopyranoside |
Formula |
C27H30O15 |
Mw |
594.15847029 |
CAS RN |
17650-84-9 |
C_ID |
C00005169
,
|
InChIKey |
RTATXGUCZHCSNG-FBSNBPALNA-N |
InChICode |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15-,17-,18+,20-,21-,22+,23+,26+,27-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)CO[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O)O)O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Agavaceae | Agave americana var.marginata | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Tordylium apulum | Ref. |
Plantae | Aristolochiaceae | Aristolochia kaempferi | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Centaurea hierapolitana | Ref. |
Plantae | Asteraceae | Clibadium spp. | Ref. |
Plantae | Asteraceae | Conyza filaginoides | Ref. |
Plantae | Asteraceae | Desmanthodium spp. | Ref. |
Plantae | Asteraceae | Montanoa tomentosa | Ref. |
Plantae | Asteraceae | Scorzonera divaricata | Ref. |
Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
Plantae | Asteraceae | Solidago altissima | Ref. |
Plantae | Boraginaceae | Alkanna orientalis | Ref. |
Plantae | Bromeliaceae | Pitcairnia spp. | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Capparaceae | Capparis spinosa L. | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Cistaceae | Cistus ladaniferus | Ref. |
Plantae | Convolvulaceae | Calystegia japonica | Ref. |
Plantae | Crassulaceae | Rhodiola rosea | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cupressaceae | Juniperus communis var.depressa | Ref. |
Plantae | Dennstaedtiaceae | Paesia anfractuosa | Ref. |
Plantae | Dioscoreaceae | Dioscorea alata | Ref. |
Plantae | Ebenaceae | Diospyros rhombifolia | Ref. |
Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
Plantae | Eucommiaceae | Eucommia ulmoides Oliv. | Ref. |
Plantae | Euphorbiaceae | Euphorbia geniculata | Ref. |
Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
Plantae | Euphorbiaceae | Euphorbia magalanta | Ref. |
Plantae | Euphorbiaceae | Euphorbia virgata | Ref. |
Plantae | Euphorbiaceae | Ricinus communis | Ref. |
Plantae | Fabaceae | Bauhinia candicans | Ref. |
Plantae | Fabaceae | Cassia hirsuta | Ref. |
Plantae | Fabaceae | Cassia spp. | Ref. |
Plantae | Fabaceae | Clitoria ternata | Ref. |
Plantae | Fabaceae | Clitoria ternatea | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
Plantae | Fabaceae | Sophora japonica | Ref. |
Plantae | Fabaceae | Styphnolobium japonicum | Ref. |
Plantae | Fumariaceae | Fumaria parviflora | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Labiatae | Marrubium velutinum | Ref. |
Plantae | Limnanthaceae | Limnanthes douglasii | Ref. |
Plantae | Longaniaceae | Strychnos spinosa | Ref. |
Plantae | Malvaceae | Kleinhovia hospita | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Nymphaeaceae | Nymphaea candida | Ref. |
Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
Plantae | Oleaceae | Nyctanthes arbortristis | Ref. |
Plantae | Oleaceae | Nyctanthes arbor-tristis Linn. | Ref. |
Plantae | Pinaceae | Abies amabilis | Ref. |
Plantae | Pinaceae | Picea abies | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Pteridaceae | Adiantum capillus-veneris | Ref. |
Plantae | Rhamnaceae | Colubrina asiatica | Ref. |
Plantae | Rhizophoraceae | Bruguiera sexangula var.rhynchopetala | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rubiaceae | Hedyotis herbacea | Ref. |
Plantae | Rubiaceae | Morinda citrifolia | Ref. |
Plantae | Rubiaceae | Morinda morindoides | Ref. |
Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
Plantae | Rubiaceae | Spermacoce laevis Roxb. | Ref. |
Plantae | Ruscaceae | Ruscus hypoglossum L. | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Solanaceae | Leucophysalis spp. | Ref. |
Plantae | Solanaceae | Nicotiana spp. | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Physalis peruviana | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
Plantae | Urticaceae | Boehmeria holosericea | Ref. |
Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
Plantae | Urticaceae | Urtica dioica | Ref. |
Plantae | Zygophyllaceae | Tribulus terrestris | Ref. |
Plantae | Zygophyllaceae | Tribulus terrstris | Ref. |
|
|
zoom in
Organism | Leptarrhena pyrolifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Hukuti,J.Pharm.Soc.Japan,59,(1939),258
Vernes,Phytochem.,15,(1976),1320 |
---|
|