Name |
Kaempferol 3-O-galactoside Trifolin Kaempferol 3-O-beta-D-galactopyranoside |
Formula |
C21H20O11 |
Mw |
448.10056148 |
CAS RN |
23627-87-4 |
C_ID |
C00005137
,
|
InChIKey |
JPUKWEQWGBDDQB-WPPCZBDQNA-N |
InChICode |
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15+,17-,18-,21+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](O1)CO)O)O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona crassiflora | Ref. |
Plantae | Apiaceae | Carum carvi | Ref. |
Plantae | Apocynaceae | Amsonia ciliata | Ref. |
Plantae | Araliaceae | Panax ginseng C.A.Meyer. | Ref. |
Plantae | Asteraceae | Clibadium spp. | Ref. |
Plantae | Asteraceae | Desmanthodium spp. | Ref. |
Plantae | Asteraceae | Scolymus hispanicus | Ref. |
Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
Plantae | Cactaceae | Opuntia ficus-indica var.saboten | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
Plantae | Casuarinaceae | Casuarina equisetifolia L. | Ref. |
Plantae | Casuarinaceae | Casuarina junghaniana | Ref. |
Plantae | Casuarinaceae | Casuarina rigida | Ref. |
Plantae | Cornaceae | Camptotheca acuminata | Ref. |
Plantae | Euphorbiaceae | Euphorbia condylocarpon | Ref. |
Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis | Ref. |
Plantae | Fabaceae | Anthyllis onobrychioides | Ref. |
Plantae | Fabaceae | Astragalus dipelta | Ref. |
Plantae | Fabaceae | Lespedeza bicolor | Ref. |
Plantae | Fabaceae | Lespedeza cuneata G. Don | Ref. |
Plantae | Fabaceae | Lespedeza tomentosa | Ref. |
Plantae | Fabaceae | Lupinus albus L. | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens L. | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
Plantae | Longaniaceae | Strychnos spinosa | Ref. |
Plantae | Malvaceae | Melochia corchorifolia | Ref. |
Plantae | Myrsinaceae | Lysimachia christinae | Ref. |
Plantae | Myrsinaceae | Lysimachia nummularia | Ref. |
Plantae | Pinaceae | Abies amabilis | Ref. |
Plantae | Pinaceae | Pinus slyvestris | Ref. |
Plantae | Pinaceae | Pinus sylvestris | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Polypodiaceae | Pyrrosia lingua | Ref. |
Plantae | Pteridaceae | Adiantum monochlamys | Ref. |
Plantae | Ranunculaceae | Consolida oliveriana | Ref. |
Plantae | Rosaceae | Prunus persica | Ref. |
Plantae | Rosaceae | Rubus hirsutus | Ref. |
Plantae | Rosaceae | Sorbaria arborea | Ref. |
Plantae | Rosaceae | Sorbaria sorbifolia | Ref. |
Plantae | Rubiaceae | Adina racemosa | Ref. |
Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
Plantae | Rubiaceae | Uncaria rhynchophylla | Ref. |
Plantae | Rutaceae | Phellodendron amurense var.wilsonii | Ref. |
Plantae | Salicaceae | Salix raddeana | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Saxifragaceae | Saxifraga stellaris | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE | Ref. |
Plantae | Velloziaceae | Barbacenia rubro-virens | Ref. |
- | - | Aceraceae negundo | Ref. |
- | - | Monochaetun multiflorum | Ref. |
|
|
zoom in
Organism | Barbacenia rubro-virens | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Hattori,Acta phytochim.Japan,13,(1943),99 |
---|
|