Name |
Kaempferol 3-O-galactoside Trifolin Kaempferol 3-O-beta-D-galactopyranoside |
Formula |
C21H20O11 |
Mw |
448.10056148 |
CAS RN |
23627-87-4 |
C_ID |
C00005137
,
|
InChIKey |
JPUKWEQWGBDDQB-WPPCZBDQNA-N |
InChICode |
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15+,17-,18-,21+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](O1)CO)O)O)O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Annona crassiflora | Ref. |
Plantae | Apiaceae | Carum carvi | Ref. |
Plantae | Apocynaceae | Amsonia ciliata | Ref. |
Plantae | Araliaceae | Panax ginseng C.A.Meyer. | Ref. |
Plantae | Asteraceae | Clibadium spp. | Ref. |
Plantae | Asteraceae | Desmanthodium spp. | Ref. |
Plantae | Asteraceae | Scolymus hispanicus | Ref. |
Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
Plantae | Cactaceae | Opuntia ficus-indica var.saboten | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
Plantae | Casuarinaceae | Casuarina equisetifolia L. | Ref. |
Plantae | Casuarinaceae | Casuarina junghaniana | Ref. |
Plantae | Casuarinaceae | Casuarina rigida | Ref. |
Plantae | Cornaceae | Camptotheca acuminata | Ref. |
Plantae | Euphorbiaceae | Euphorbia condylocarpon | Ref. |
Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis | Ref. |
Plantae | Fabaceae | Anthyllis onobrychioides | Ref. |
Plantae | Fabaceae | Astragalus dipelta | Ref. |
Plantae | Fabaceae | Lespedeza bicolor | Ref. |
Plantae | Fabaceae | Lespedeza cuneata G. Don | Ref. |
Plantae | Fabaceae | Lespedeza tomentosa | Ref. |
Plantae | Fabaceae | Lupinus albus L. | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Fabaceae | Trifolium repens L. | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
Plantae | Longaniaceae | Strychnos spinosa | Ref. |
Plantae | Malvaceae | Melochia corchorifolia | Ref. |
Plantae | Myrsinaceae | Lysimachia christinae | Ref. |
Plantae | Myrsinaceae | Lysimachia nummularia | Ref. |
Plantae | Pinaceae | Abies amabilis | Ref. |
Plantae | Pinaceae | Pinus slyvestris | Ref. |
Plantae | Pinaceae | Pinus sylvestris | Ref. |
Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
Plantae | Polypodiaceae | Pyrrosia lingua | Ref. |
Plantae | Pteridaceae | Adiantum monochlamys | Ref. |
Plantae | Ranunculaceae | Consolida oliveriana | Ref. |
Plantae | Rosaceae | Prunus persica | Ref. |
Plantae | Rosaceae | Rubus hirsutus | Ref. |
Plantae | Rosaceae | Sorbaria arborea | Ref. |
Plantae | Rosaceae | Sorbaria sorbifolia | Ref. |
Plantae | Rubiaceae | Adina racemosa | Ref. |
Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
Plantae | Rubiaceae | Uncaria rhynchophylla | Ref. |
Plantae | Rutaceae | Phellodendron amurense var.wilsonii | Ref. |
Plantae | Salicaceae | Salix raddeana | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Saxifragaceae | Saxifraga stellaris | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Theaceae | Camellia sinensis (L.) O.KUNTZE | Ref. |
Plantae | Velloziaceae | Barbacenia rubro-virens | Ref. |
- | - | Aceraceae negundo | Ref. |
- | - | Monochaetun multiflorum | Ref. |
|
|
zoom in
Organism | Sorbaria sorbifolia | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chem Abstr, 123, (1995), 334968a.
Zhang, et al., Planta Med, 70, (2004), 1216.
YUAN, et al., Chem Pharm Bull, 53, (2005), 1610.
Wu, et al., JNP, 66, (2003), 1207.
Itoh, et al., JNP, 66, (2003), 1212 |
---|
|