Name |
Chrysosplenetin 5,4'-Dihydroxy-3,6,7,3'-tetramethoxyflavone Quercetagetin 3,6,7,3'-tetramethyl ether Polycladin 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
Formula |
C19H18O8 |
Mw |
374.10016755 |
CAS RN |
603-56-5 |
C_ID |
C00004704
,
|
InChIKey |
NBVTYGIYKCPHQN-UHFFFAOYSA-N |
InChICode |
InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)O)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea ageratum | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia mongolica | Ref. |
Plantae | Asteraceae | Artemisia sieversiana | Ref. |
Plantae | Asteraceae | Blumea malcomii | Ref. |
Plantae | Asteraceae | Grindelia robusta | Ref. |
Plantae | Asteraceae | Grindelia tarapacana | Ref. |
Plantae | Asteraceae | Haplopappus bezanillanus | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Parthenium incanum | Ref. |
Plantae | Asteraceae | Parthenium rollinsianum | Ref. |
Plantae | Asteraceae | Pulicaria gnaphaloides | Ref. |
Plantae | Betulaceae | Alnus koehnei | Ref. |
Plantae | Capparaceae | Cleome spp. | Ref. |
Plantae | Labiatae | Plectranthus marrubioides | Ref. |
Plantae | Labiatae | Stachys aegyptiaca | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Plantaginaceae | Adenosma capitatum | Ref. |
Plantae | Plantaginaceae | Digitalis thapsi | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Saxifragaceae | Chrysosplenium japonicum | Ref. |
Plantae | Saxifragaceae | Chrysosplenium tosaense | Ref. |
|
|
zoom in
Organism | Inula britannica | Reference | Wollenweber,Proceeding of the International Compositae Conference,(1994) |
---|
|