Name |
Chrysosplenol D 5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone Quercetagetin 3,6,7-Trimethyl ether 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
Formula |
C18H16O8 |
Mw |
360.08451749 |
CAS RN |
14965-20-9 |
C_ID |
C00004692
,
|
InChIKey |
BYWLLSQTJBXAPV-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)O)O)OC)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea clusiana | Ref. |
Plantae | Asteraceae | Ageratina havanensis | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia australis | Ref. |
Plantae | Asteraceae | Artemisia mongolica | Ref. |
Plantae | Asteraceae | Blumea malcomii | Ref. |
Plantae | Asteraceae | Brickellia eupatorioides | Ref. |
Plantae | Asteraceae | Flourensia cernua | Ref. |
Plantae | Asteraceae | Hemizonia lutescens | Ref. |
Plantae | Asteraceae | Heterotheca villosa | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Inula germanica | Ref. |
Plantae | Asteraceae | Madia sativa | Ref. |
Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
Plantae | Asteraceae | Pulicaria gnaphaloides | Ref. |
Plantae | Asteraceae | Tanacetum polycephalum | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
Plantae | Labiatae | Cyanostegia microphylla | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Rosaceae | Rosa centifolia | Ref. |
Plantae | Saxifragaceae | Chrysosplenium tosaense | Ref. |
|
|
zoom in
Organism | Chrysosplenium tosaense | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ghisalberti,Aust.J.Chem.,20,(1967),1049
Shimizu,Chem.Pharm.Bull.,16,(1968),2310 |
---|
|