Name |
Axillarin 3,6-Dimethoxy-5,7,3',4'-tetrahydroxyflavone Quercetagetin 3,6-dimethyl ether 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
Formula |
C17H14O8 |
Mw |
346.06886743 |
CAS RN |
5188-73-8 |
C_ID |
C00004684
,
|
InChIKey |
KIGVXRGRNLQNNI-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
SMILES |
c1(c(c(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)O)O)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Achillea spp. | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Ambrosia chamissonis | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia australis | Ref. |
Plantae | Asteraceae | Asteriscus sericeus | Ref. |
Plantae | Asteraceae | Bahia pringlei | Ref. |
Plantae | Asteraceae | Calycadenia spp. | Ref. |
Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
Plantae | Asteraceae | Eriophyllum confertiflorum | Ref. |
Plantae | Asteraceae | Eriophyllum staechadifolium | Ref. |
Plantae | Asteraceae | Flourensia hirsuta | Ref. |
Plantae | Asteraceae | Gonospermum elegans | Ref. |
Plantae | Asteraceae | Gonospermum gomerae | Ref. |
Plantae | Asteraceae | Gymnosperma glutinosum | Ref. |
Plantae | Asteraceae | Helichrysum spp. | Ref. |
Plantae | Asteraceae | Holocarpha heermannii | Ref. |
Plantae | Asteraceae | Inula britannica | Ref. |
Plantae | Asteraceae | Inula germanica | Ref. |
Plantae | Asteraceae | Iva axillaris | Ref. |
Plantae | Asteraceae | Iva hayesiana | Ref. |
Plantae | Asteraceae | Madia sativa | Ref. |
Plantae | Asteraceae | Madia spp. | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
Plantae | Asteraceae | Tanacetum balsamita | Ref. |
Plantae | Asteraceae | Tanacetum parthenium | Ref. |
Plantae | Asteraceae | Tanacetum vulgare | Ref. |
Plantae | Asteraceae | Xanthium pensylvanicum | Ref. |
Plantae | Asteraceae | Xanthium strumarium | Ref. |
Plantae | Capparaceae | Cleome amplyocarpa | Ref. |
Plantae | Cistaceae | Cistus albanicus | Ref. |
Plantae | Didiereaceae | Didierea spp. | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Rutaceae | Dictamnus albus | Ref. |
|
|
zoom in
Organism | Iva axillaris | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Taylor,Tetrahedron Lett.,(1965),3675 |
---|
|