Name |
Quercetin 7,3',4'-trimethyl ether 3,5-Dihydroxy-7,3',4'-trimethoxyflavone 2-(3,4-Dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1-benzopyran-4-one |
Formula |
C18H16O7 |
Mw |
344.08960287 |
CAS RN |
6068-80-0 |
C_ID |
C00004649
,
|
InChIKey |
OEEUHNAUMMATJT-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)OC)OC)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Chromolaena odorata | Ref. |
Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
Plantae | Asteraceae | Haplopappus sp. | Ref. |
Plantae | Cistaceae | Cistus spp. | Ref. |
Plantae | Crassulaceae | Aeonium arboreum | Ref. |
Plantae | Geraniaceae | Geranium spp. | Ref. |
Plantae | Hydrophyllaceae | Wigandia urens | Ref. |
Plantae | Lennoaceae | Lennoa madreporoides | Ref. |
Plantae | Malvaceae | Kitaibelia vitifolia | Ref. |
Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
Plantae | Solanaceae | Solanum pennellii | Ref. |
Plantae | Zingiberaceae | Amomum koenigii | Ref. |
Plantae | Zygophyllaceae | Larrea cuneifolia | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata | Ref. |
|
|
zoom in
Organism | Solanum pennellii | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wollenweber,Tetrahedron Lett.,(1970),1601 |
---|
|