Name |
Ayanin 3,7,4'-Tri-O-methylquercetin 5,3'-Dihydroxy-3,7,4'-trimethoxyflavone 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one Ayarin |
Formula |
C18H16O7 |
Mw |
344.08960287 |
CAS RN |
572-32-7 |
C_ID |
C00004647
,
|
InChIKey |
KPCRYSMUMBNTCK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-13(23-2)11(19)6-9/h4-8,19-20H,1-3H3 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)OC)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ageratina havanensis | Ref. |
Plantae | Asteraceae | Bahia glandulosa | Ref. |
Plantae | Asteraceae | Encelia spp. | Ref. |
Plantae | Asteraceae | Eupatorium triplinerve | Ref. |
Plantae | Asteraceae | Grindelia squarrosa | Ref. |
Plantae | Asteraceae | Gutierrezia alamanii | Ref. |
Plantae | Asteraceae | Haplopappus chrysanthemifolius | Ref. |
Plantae | Asteraceae | Haplopappus hirtellus | Ref. |
Plantae | Asteraceae | Heterotheca inuloides | Ref. |
Plantae | Asteraceae | Isocoma spp. | Ref. |
Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
Plantae | Asteraceae | Pterocaulon virgatum | Ref. |
Plantae | Asteraceae | Stevia subpubescens | Ref. |
Plantae | Boraginaceae | Heliotropium chenopodiaceum var. ericoideum | Ref. |
Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
Plantae | Cunoniaceae | Eucryphia lucida | Ref. |
Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
Plantae | Escalloniaceae | Escallonia spp. | Ref. |
Plantae | Fabaceae | Distemonanthus benthamianus | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
Plantae | Labiatae | Hyptis brevipes | Ref. |
Plantae | Labiatae | Salvia glutinosa | Ref. |
Plantae | Orchidaceae | Dendrobium densiflorum Lindl.ex.Wall. | Ref. |
Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
Plantae | Solanaceae | Petunia surfinia | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Verbenaceae | Lantana camara | Ref. |
Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
Plantae | Zingiberaceae | Amomum koenigii | Ref. |
Plantae | Zingiberaceae | Kaempferia parviflora | Ref. |
- | - | Siegesbeckia jorullensis | Ref. |
- | - | Siegesbeckia orientalis | Ref. |
|
|
zoom in
Organism | Eriodictyon trichocalyx | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
King,J.Chem.Soc.,(1952),92 |
---|
|