Name |
Quercetin 3,7-dimethyl ether 5,3',4'-Trihydroxy-3,7-dimethoxyflavone 2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one 3,7-Di-O-methylquercetin |
Formula |
C17H14O7 |
Mw |
330.0739528 |
CAS RN |
2068-02-2 |
C_ID |
C00004638
,
|
InChIKey |
LUJAXSNNYBCFEE-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3 |
SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccc(O)c(O)c3)oc2c1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ageratina havanensis | Ref. |
Plantae | Asteraceae | Artemisia spp. | Ref. |
Plantae | Asteraceae | Baccharis pilularis | Ref. |
Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
Plantae | Asteraceae | Eirmocephala megaphylla | Ref. |
Plantae | Asteraceae | Flourensia cernua | Ref. |
Plantae | Asteraceae | Grindelia tarapacana | Ref. |
Plantae | Asteraceae | Haplopappus taeda | Ref. |
Plantae | Asteraceae | Holocarpha spp. | Ref. |
Plantae | Asteraceae | Ozothamnus lycopodioides | Ref. |
Plantae | Asteraceae | Ozothamnus scutellifolius | Ref. |
Plantae | Asteraceae | Palafoxia sphacelata | Ref. |
Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
Plantae | Calceolariaceae | Calceolaria spp. | Ref. |
Plantae | Crassulaceae | Aeonium manriquiorum | Ref. |
Plantae | Cunoniaceae | Eucryphia milliganii | Ref. |
Plantae | Cunoniaceae | Eucryphia moorei | Ref. |
Plantae | Cyperaceae | Cyperus spp. | Ref. |
Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
Plantae | Geraniaceae | Pelargonium fulgidum | Ref. |
Plantae | Geraniaceae | Pelargonium quercifolium | Ref. |
Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
Plantae | Phrymaceae | Mimulus cardinalis | Ref. |
Plantae | Rosaceae | Rubus phoenicolasius | Ref. |
Plantae | Santalaceae | Viscum album | Ref. |
Plantae | Santalaceae | Viscum cruciatum | Ref. |
Plantae | Solanaceae | Petunia surfinia | Ref. |
Plantae | Solanaceae | Salpiglossis sinuata | Ref. |
Plantae | Solanaceae | Solanum pennellii | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Verbenaceae | Lantana camara | Ref. |
Plantae | Zygophyllaceae | Larrea cuneifolia | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata | Ref. |
- | - | Siegesbeckia jorullensis | Ref. |
- | - | Siegesbeckia orientalis | Ref. |
- | - | Wallastonia bifora | Ref. |
|
|
zoom in
Organism | Larrea divaricata | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|