Name |
Azaleatin |
Formula |
C16H12O7 |
Mw |
316.05830274 |
CAS RN |
529-51-1 |
C_ID |
C00004633
,
|
InChIKey |
RJBAXROZAXAEEM-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O7/c1-22-11-5-8(17)6-12-13(11)14(20)15(21)16(23-12)7-2-3-9(18)10(19)4-7/h2-6,17-19,21H,1H3 |
SMILES |
COc1cc(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c12 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Cunoniaceae | Eucryphia glutinosa | Ref. |
Plantae | Dilleniaceae | Tetracera spp. | Ref. |
Plantae | Ericaceae | Cassiope spp. | Ref. |
Plantae | Ericaceae | Kalmiopsis leachiana | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Parkia biglobosa | Ref. |
Plantae | Fabaceae | Senna lindheimeriana | Ref. |
Plantae | Fabaceae | Tephrosia watsoniana | Ref. |
Plantae | Juglandaceae | Carya pecan | Ref. |
Plantae | Lauraceae | Beilschmiedia miersii | Ref. |
Plantae | Plumbaginaceae | Plumbago spp. | Ref. |
|
|
zoom in
Organism | Kalmiopsis leachiana | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wada,J.Am.Chem.Soc.,78,(1956),4725 |
---|
|