Name |
4',7-Dihydroxyflavonol Resokaempferol |
Formula |
C15H10O5 |
Mw |
270.05282343 |
CAS RN |
2034-65-3 |
C_ID |
C00004540
,
|
InChIKey |
OBWHQJYOOCRPST-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)15-14(19)13(18)11-6-5-10(17)7-12(11)20-15/h1-7,16-17,19H |
SMILES |
c1(ccc2c(c1)oc(c(c2=O)O)c1ccc(cc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Anacardiaceae | Rhus spp. | Ref. |
Plantae | Anacardiaceae | Schinopsis lorentzii | Ref. |
Plantae | Fabaceae | Acacia spp. | Ref. |
Plantae | Fabaceae | Anthyllis vulneraria | Ref. |
Plantae | Fabaceae | Baptisia calycosa | Ref. |
Plantae | Fabaceae | Baptisia lecontei | Ref. |
Plantae | Fabaceae | Baptisia simplicifolia | Ref. |
Plantae | Fabaceae | Butea spp. | Ref. |
Plantae | Fabaceae | Cicer arietinum | Ref. |
Plantae | Fabaceae | Dorycnium pentaphyllum | Ref. |
Plantae | Fabaceae | Lathyrus pratensis | Ref. |
Plantae | Fabaceae | Lens culinaris | Ref. |
Plantae | Fabaceae | Lotus corniculatus | Ref. |
Plantae | Fabaceae | Lotus maritimus | Ref. |
Plantae | Fabaceae | Millettia spp. | Ref. |
Plantae | Fabaceae | Platymiscium praecox | Ref. |
Plantae | Fabaceae | Pterocarpus marsupium | Ref. |
Plantae | Fabaceae | Robinia pseudoacacia | Ref. |
Plantae | Fabaceae | Sophora secundiflora | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Fabaceae | Trifolium subterraneum | Ref. |
Plantae | Fabaceae | Ulex spp. | Ref. |
Plantae | Fabaceae | Umtiza listerana | Ref. |
|
|
zoom in
Organism | Sophora secundiflora | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Kirby,Biochem.J.,60,(1955),582
Wong,Phytochem.,4,(1965),89 |
---|
|