Name |
Galangin Norizalpinin 3,5,7-Trihydroxyflavone 3,5,7-Trihydroxy-2-phenyl-4H-1-benzopyran-4-one |
Formula |
C15H10O5 |
Mw |
270.05282343 |
CAS RN |
548-83-4 |
C_ID |
C00004533
,
|
InChIKey |
VCCRNZQBSJXYJD-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccccc1)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Baccharis viminea | Ref. |
Plantae | Asteraceae | Cassinia quinquefaria | Ref. |
Plantae | Asteraceae | Flourensia cernua | Ref. |
Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
Plantae | Asteraceae | Helichrysum aureonitens | Ref. |
Plantae | Asteraceae | Helichrysum aureum | Ref. |
Plantae | Asteraceae | Heterothalamus psiadioides | Ref. |
Plantae | Asteraceae | Odixia spp. | Ref. |
Plantae | Betulaceae | Alnus pendula | Ref. |
Plantae | Boraginaceae | Heliotropium filifolium | Ref. |
Plantae | Boraginaceae | Heliotropium subulatum | Ref. |
Plantae | Boraginaceae | Heliotropium taltalense | Ref. |
Plantae | Datiscaceae | Datisca cannabina | Ref. |
Plantae | Escalloniaceae | Escallonia spp. | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Millettia racemosa | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Grossulariaceae | Ribes viscosissimum | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum pampaninii | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Scutellaria galericulata | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus alessandri | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Salicaceae | Populus nigra | Ref. |
Plantae | Taxaceae | Taxus fuana | Ref. |
Plantae | Taxaceae | Taxus yunnanensis | Ref. |
Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
Plantae | Zamiaceae | Apis mellifera ligustica | Ref. |
Plantae | Zingiberaceae | Alpinia galanga | Ref. |
Plantae | Zingiberaceae | Alpinia officinarum | Ref. |
Plantae | Zingiberaceae | Zingiber mioga | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
Organism | Origanum hypercifolium | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|