Name |
Lonicerin Luteolin 7-neohesperidoside Veronicastroside |
Formula |
C27H30O15 |
Mw |
594.15847029 |
CAS RN |
25694-72-8 |
C_ID |
C00004283
, 
|
InChIKey |
SHPPXMGVUDNKLV-DPFBLAHTNA-N |
InChICode |
InChI=1S/C27H30O15/c1-9-20(33)22(35)24(37)26(38-9)42-25-23(36)21(34)18(8-28)41-27(25)39-11-5-14(31)19-15(32)7-16(40-17(19)6-11)10-2-3-12(29)13(30)4-10/h2-7,9,18,20-31,33-37H,8H2,1H3/t9-,18+,20-,21+,22-,23-,24+,25+,26-,27+/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | -- | Lonicera japonica  | Ref. |
Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium  | Ref. |
Plantae | Araceae | Colocasia esculenta  | Ref. |
Plantae | Asteraceae | Chrysanthemum morifolium  | Ref. |
Plantae | Asteraceae | Saussurea medusa | Ref. |
Plantae | Labiatae | Thymus membranaceus | Ref. |
Plantae | Plantaginaceae | Veronicastrum sibiricum | Ref. |
Plantae | Poaceae | Cymbopogon citratus  | Ref. |
Plantae | Polypodiaceae | Drynaria fortunei Kunze J.SM.  | Ref. |
Plantae | Rutaceae | Citrus aurantium  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
|
|
zoom in
Organism | Veronicastrum sibiricum | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Teslov,Khim.Prir.Soedin.,(1980),334 |
---|
|