Name |
Cinaroside Cynaroside Luteolin 7-glucoside Luteolin 7-O-beta-D-glucopyranoside Luteolin 7-O-beta-D-glucoside Luteolin 7-O-beta-glucopyranoside Luteolin 7-O-beta-glucoside Luteolin 7-O-glucoside |
Formula |
C21H20O11 |
Mw |
448.10056148 |
CAS RN |
5373-11-5 |
C_ID |
C00004266
,
|
InChIKey |
PEFNSGRTCBGNAN-OHPGNTIMNA-N |
InChICode |
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Araceae | Colocasia esculenta | Ref. |
Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
Plantae | Asteraceae | Achyrocline satureioides | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chrysanthemum indicum | Ref. |
Plantae | Asteraceae | Chrysanthemum morifolium | Ref. |
Plantae | Asteraceae | Gnaphalium affine | Ref. |
Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
Plantae | Asteraceae | Helichrysum graveolen | Ref. |
Plantae | Asteraceae | Lactuca indica | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Onopordum acanthium | Ref. |
Plantae | Asteraceae | Santolina chamaecyperissus | Ref. |
Plantae | Asteraceae | Saussurea medusa | Ref. |
Plantae | Asteraceae | Tessaria dodoneifolia | Ref. |
Plantae | Asteraceae | Thelesperma megapotamicum | Ref. |
Plantae | Betulaceae | Betula nigra | Ref. |
Plantae | Bromeliaceae | Aechmea glomerata | Ref. |
Plantae | Cannabaceae | Humulus japonicus | Ref. |
Plantae | Caryophyllaceae | Melandrium album | Ref. |
Plantae | Colchicaceae | Wurmbea dioica F.Muell. | Ref. |
Plantae | Commelinaceae | Commelina communis | Ref. |
Plantae | Conocephalaceae | Conocephalum conicum | Ref. |
Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
Plantae | Dilleniaceae | Dillenia indica | Ref. |
Plantae | Fabaceae | Acacia caven | Ref. |
Plantae | Fabaceae | Acacia furcatispina | Ref. |
Plantae | Fabaceae | Ammothamnus lehmanni Bge. | Ref. |
Plantae | Fabaceae | Cassia tora | Ref. |
Plantae | Fabaceae | Hymenaea palustris Ducke | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
Plantae | Gentianaceae | Gentiana argentea | Ref. |
Plantae | Gentianaceae | Gentiana depressa | Ref. |
Plantae | Gentianaceae | Gentiana elwesii | Ref. |
Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
Plantae | Gentianaceae | Gentiana prolata | Ref. |
Plantae | Gentianaceae | Gentiana sikkimensis | Ref. |
Plantae | Jubulaceae | Frullania dilatata | Ref. |
Plantae | Jubulaceae | Frullania tamarisci | Ref. |
Plantae | Labiatae | Dracocephalum rupestre | Ref. |
Plantae | Labiatae | Mentha aquatica L. | Ref. |
Plantae | Labiatae | Mentha piperitae | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
Plantae | Labiatae | Prunella vulgaris | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Schizonepeta tenuifolia | Ref. |
Plantae | Labiatae | Scutellaria oreophila | Ref. |
Plantae | Labiatae | Thymus austriacus | Ref. |
Plantae | Labiatae | Thymus citriodorus | Ref. |
Plantae | Labiatae | Thymus longicaulis | Ref. |
Plantae | Labiatae | Thymus membranaceus | Ref. |
Plantae | Labiatae | Thymus numidicus | Ref. |
Plantae | Labiatae | Thymus oblongifolius | Ref. |
Plantae | Labiatae | Thymus praecox | Ref. |
Plantae | Labiatae | Thymus pulegioides | Ref. |
Plantae | Labiatae | Thymus serpyllum | Ref. |
Plantae | Labiatae | Thymus sibthorpii | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Sida galheirensis | Ref. |
Plantae | Malvaceae | Theobroma cacao L. | Ref. |
Plantae | Plantaginaceae | Plantago argentea | Ref. |
Plantae | Plantaginaceae | Plantago holosteum | Ref. |
Plantae | Plantaginaceae | Plantago major | Ref. |
Plantae | Plantaginaceae | Plantago maritima | Ref. |
Plantae | Plantaginaceae | Veronica fuhsii | Ref. |
Plantae | Plantaginaceae | Veronica montana | Ref. |
Plantae | Plantaginaceae | Veronica peregrina L. | Ref. |
Plantae | Plantaginaceae | Veronica polita | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Plantaginaceae | Veronica spuria | Ref. |
Plantae | Plantaginaceae | Veronicastrum sibiricum | Ref. |
Plantae | Plantaginaceae | Veronica thymoides ssp.pseudocinerea | Ref. |
Plantae | Poaceae | Cymbopogon citratus | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Polygonaceae | Polygonum cuspidatum | Ref. |
Plantae | Ricciaceae | Riccia fluitans L | Ref. |
Plantae | Rosaceae | Agrimonia pilosa var.japonica | Ref. |
Plantae | Rosaceae | Spiraea hypericifolia | Ref. |
Plantae | Rubiaceae | Morinda morindoides | Ref. |
Plantae | Salicaceae | Salix babylonica | Ref. |
Plantae | Salicaceae | Salix cheilophila | Ref. |
Plantae | Salicaceae | Salix matsudana | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana chionophila | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana fedtschenkoi | Ref. |
Plantae | Verbenaceae | Clerodendron serratum | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Verbenaceae | Verbena hybrida | Ref. |
Plantae | Verbenaceae | Verbena officinalis | Ref. |
- | - | Echinop ritro | Ref. |
- | - | Traxacum officinale | Ref. |
|
|
zoom in
Organism | Thymus longicaulis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|