Name |
Thymonin Majoranin Mucroflavone B 5,6,4'-Trihydroxy-7,8,3'-trimethoxyflavone 5,6-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one |
Formula |
C18H16O8 |
Mw |
360.08451749 |
CAS RN |
76844-67-2 |
C_ID |
C00003931
,
|
InChIKey |
BAIRXMVFPKLWSE-UHFFFAOYSA-N |
InChICode |
InChI=1S/C18H16O8/c1-23-12-6-8(4-5-9(12)19)11-7-10(20)13-14(21)15(22)17(24-2)18(25-3)16(13)26-11/h4-7,19,21-22H,1-3H3 |
SMILES |
c1(c(c(c2c(c1OC)oc(cc2=O)c1ccc(c(c1)OC)O)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Madia capitata | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Mentha longifolia | Ref. |
Plantae | Labiatae | Mentha pulegium | Ref. |
Plantae | Labiatae | Mentha spicata | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Labiatae | Mentha suaveolens | Ref. |
Plantae | Labiatae | Mentha x piperita | Ref. |
Plantae | Labiatae | Micromeria spp. | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum calcaratum | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum floribundum | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum intercedens | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum microphyllum | Ref. |
Plantae | Labiatae | Origanum onites | Ref. |
Plantae | Labiatae | Origanum spp. | Ref. |
Plantae | Labiatae | Origanum syriacum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Glandulosum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Hirtum | Ref. |
Plantae | Labiatae | Satureja salzmannii | Ref. |
Plantae | Labiatae | Thymus caespititius | Ref. |
Plantae | Labiatae | Thymus mastichina | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Lamiaceae | Acinos alpinus | Ref. |
Plantae | Lamiaceae | Acinos suaveolens | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
Plantae | Lamiaceae | Calamintha sylvatica | Ref. |
- | - | Majorana hortensis | Ref. |
|
|
zoom in
Organism | Origanum floribundum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|