Name |
Jaceosidin 5,7,4'-Trihydroxy-6,3'-dimethoxyflavone |
Formula |
C17H14O7 |
Mw |
330.0739528 |
CAS RN |
18085-97-7 |
C_ID |
C00003890
,
|
InChIKey |
GLAAQZFBFGEBPS-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)O)O)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia vestita | Ref. |
Plantae | Asteraceae | Baccharis gaudichaudiana DC | Ref. |
Plantae | Asteraceae | Centaurea arguta | Ref. |
Plantae | Asteraceae | Centaurea hierapolitana | Ref. |
Plantae | Asteraceae | Centaurea jacea | Ref. |
Plantae | Asteraceae | Eupatorium capillifolium | Ref. |
Plantae | Asteraceae | Helenium alternifolium | Ref. |
Plantae | Bromeliaceae | Tillandsia utriculata | Ref. |
Plantae | Chenopodiaceae | Chenopodium ambrosioides | Ref. |
Plantae | Labiatae | Mentha pulegium | Ref. |
Plantae | Labiatae | Salvia tomentosa | Ref. |
Plantae | Labiatae | Salvia triloba | Ref. |
Plantae | Plantaginaceae | Digitalis lanata | Ref. |
Plantae | Plantaginaceae | Digitalis schischkinii | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Rubiaceae | Morinda citrifolia | Ref. |
Plantae | Rutaceae | Citrus sudachi | Ref. |
Plantae | Zosteraceae | Phyllospadix japonicus | Ref. |
|
|
zoom in
Organism | Digitalis schischkinii | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
ApSimon,J.Chem.Soc.,(1963),3789
Wollenweber,Phytochem.,29,(1990),633 |
---|
|