Name |
Gardenin B Demethyltangeretin 5-Hydroxy-6,7,8-trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
Formula |
C19H18O7 |
Mw |
358.10525293 |
CAS RN |
2798-20-1 |
C_ID |
C00003883
,
|
InChIKey |
LXEVSYZNYDZSOB-UHFFFAOYSA-N |
InChICode |
InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)13-9-12(20)14-15(21)17(23-2)19(25-4)18(24-3)16(14)26-13/h5-9,21H,1-4H3 |
SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Baccharis grisebachii | Ref. |
Plantae | Asteraceae | Brickellia squarrosa | Ref. |
Plantae | Asteraceae | Psiadia punctulata | Ref. |
Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
Plantae | Bignoniaceae | Godmania aesculifolia | Ref. |
Plantae | Fabaceae | Ononis natrix | Ref. |
Plantae | Labiatae | Cunila angustifolia | Ref. |
Plantae | Labiatae | Cunila fasciculata | Ref. |
Plantae | Labiatae | Hyptis tomentosa | Ref. |
Plantae | Labiatae | Mentha piperita | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Labiatae | Mentha x citrata | Ref. |
Plantae | Labiatae | Mentha x piperita | Ref. |
Plantae | Labiatae | Nepeta transcaucasica | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
Plantae | Labiatae | Ocimum basilicum L. | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicum L. | Ref. |
Plantae | Labiatae | Ocimum minimum L. | Ref. |
Plantae | Labiatae | Ocimum selloi Benth. | Ref. |
Plantae | Labiatae | Ocimum spp. | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum L. | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Origanum calcaratum | Ref. |
Plantae | Labiatae | Origanum dictamnus | Ref. |
Plantae | Labiatae | Origanum floribundum | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum microphyllum | Ref. |
Plantae | Labiatae | Origanum onites | Ref. |
Plantae | Labiatae | Origanum syriacum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Glandulosum | Ref. |
Plantae | Labiatae | Origanum vulgare subsp. Hirtum | Ref. |
Plantae | Labiatae | Satureja montana | Ref. |
Plantae | Labiatae | Sideritis jahandiezii | Ref. |
Plantae | Rosaceae | Rosa centifolia | Ref. |
Plantae | Rubiaceae | Gardenia lucida | Ref. |
Plantae | Rutaceae | Citrus jambhiri | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sinensis, | Ref. |
Plantae | Tamaricaceae | Tamarix dioica | Ref. |
|
|
zoom in
Organism | Origanum syriacum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|