Name |
4'-Methylcapillarisin Pectolinarigenin |
Formula |
C17H14O6 |
Mw |
314.07903818 |
CAS RN |
520-12-7 |
C_ID |
C00003838
,
|
InChIKey |
GPQLHGCIAUEJQK-UHFFFAOYSA-N |
InChICode |
InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)OC)O)OC)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Ambrosia camphorata | Ref. |
Plantae | Asteraceae | Artemisia capillaris | Ref. |
Plantae | Asteraceae | Artemisia vestita | Ref. |
Plantae | Asteraceae | Iva frutescens | Ref. |
Plantae | Fabaceae | Cassia renigera | Ref. |
Plantae | Labiatae | Clerodendrum phlomidis | Ref. |
Plantae | Labiatae | Mentha pulegium | Ref. |
Plantae | Labiatae | Salvia hypoleuca | Ref. |
Plantae | Labiatae | Salvia pedicellata | Ref. |
Plantae | Labiatae | Salvia yosgadensis | Ref. |
Plantae | Nothofagaceae/Fagaceae | Nothofagus dombeyi | Ref. |
Plantae | Plantaginaceae | Digitalis schischkinii | Ref. |
Plantae | Plantaginaceae | Linaria japonicum | Ref. |
Plantae | Plantaginaceae | Linaria vulgaris | Ref. |
Plantae | Verbenaceae | Clerodendron inerme | Ref. |
Plantae | Verbenaceae | Duranta plumieri | Ref. |
Plantae | Verbenaceae | Duranta repens | Ref. |
Plantae | Zosteraceae | Phyllospadix japonicus | Ref. |
|
|
zoom in
Organism | Clerodendrum phlomidis | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harbone, Comparative Biochemisty of the Flavonoids,(1965),39, Academic Press
Wollenweber, J.Plant Physiol.,131,(1987),37 |
---|
|