Name |
Scutellarein 6-Hydroxyapigenin |
Formula |
C15H10O6 |
Mw |
286.04773805 |
CAS RN |
529-53-3 |
C_ID |
C00003834
,
|
InChIKey |
JVXZRQGOGOXCEC-UHFFFAOYSA-N |
InChICode |
InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
Plantae | Asteraceae | Centaurea jacea | Ref. |
Plantae | Asteraceae | Pulicaria dysenterica | Ref. |
Plantae | Bignoniaceae | Millingtonia hortensis | Ref. |
Plantae | Bignoniaceae | Oroxylum indicum | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia andamanica | Ref. |
Plantae | Fabaceae | Baptisia calycosa | Ref. |
Plantae | Labiatae | Clerodendrum phlomidis | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Scutellaria barbata | Ref. |
Plantae | Labiatae | Scutellaria indica | Ref. |
Plantae | Labiatae | Scutellaria rivularis | Ref. |
Plantae | Labiatae | Scutellaria scandens | Ref. |
Plantae | Labiatae | Scutellaria spp. | Ref. |
Plantae | Plantaginaceae | Scoparia dulcis | Ref. |
Plantae | Polygonaceae | Polygonum hydropiper L. | Ref. |
Plantae | Polygonaceae | Polygonum viscosum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Verbenaceae | Clerodendron fragrans | Ref. |
Plantae | Verbenaceae | Clerodendron phlomoides | Ref. |
Plantae | Verbenaceae | Clerodendron serratum | Ref. |
Plantae | Verbenaceae | Duranta plumieri | Ref. |
Plantae | Verbenaceae | Duranta repens | Ref. |
- | - | Scutettaria baicalensis | Ref. |
|
|
zoom in
Organism | Scutellaria rivularis | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harbone, Comparative Biochemisty of the Flavonoids,(1965),39, Academic Press
Subramanian,Phytochem.11,(1972),3095 |
---|
|