Name |
Acacetin 5,7-Dihydroxy-4'-methoxyflavone Apigenin 4'-methyl ether |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
480-44-4 |
C_ID |
C00003820
,
|
InChIKey |
DANYIYRPLHHOCZ-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)14-8-13(19)16-12(18)6-10(17)7-15(16)21-14/h2-8,17-18H,1H3 |
SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
Plantae | Asteraceae | Artemisia minor | Ref. |
Plantae | Asteraceae | Artemisia vestita | Ref. |
Plantae | Asteraceae | Chrysanthemum leucanthemum | Ref. |
Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
Plantae | Asteraceae | Eupatorium tinifolium | Ref. |
Plantae | Betulaceae | Ostrya japonica | Ref. |
Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fabaceae | Dalbergia odorifera | Ref. |
Plantae | Fabaceae | Indigofera tetrantha | Ref. |
Plantae | Fabaceae | Robinia pseudoacacia | Ref. |
Plantae | Fabaceae | Trifolium repens | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Iridaceae | Crocus aureus | Ref. |
Plantae | Iridaceae | Crocus heuffelianus | Ref. |
Plantae | Iridaceae | Crocus laevigatus | Ref. |
Plantae | Labiatae | Callicarpa pilosissima | Ref. |
Plantae | Labiatae | Leucas aspera | Ref. |
Plantae | Labiatae | Mentha aquatica | Ref. |
Plantae | Labiatae | Mentha longifolia | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton | Ref. |
Plantae | Labiatae | Ocimum basilicum L. | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Origanum akhadarense | Ref. |
Plantae | Labiatae | Origanum boissieri | Ref. |
Plantae | Labiatae | Origanum hypercifolium | Ref. |
Plantae | Labiatae | Origanum majorana | Ref. |
Plantae | Labiatae | Origanum micranthum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Salvia nicolsoniana | Ref. |
Plantae | Labiatae | Salvia yosgadensis | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Malvaceae | Sida rhombifolia | Ref. |
Plantae | Plantaginaceae | Scoparia dulcis L. | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
Plantae | Rutaceae | Ruta graveolens | Ref. |
Plantae | Solanaceae | Capsicum annuum | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana chionophila | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana fedtschenkoi | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana spryginii | Ref. |
Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
Plantae | Verbenaceae | Verbena hybrida | Ref. |
|
|
zoom in
Organism | Origanum micranthum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|