| Name |
Thevetiaflavone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
29376-68-9 |
| C_ID |
C00003819
, 
|
| InChIKey |
YQABHAHJGSNVQR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-14-6-11(18)7-15-16(14)12(19)8-13(21-15)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| SMILES |
COc1cc(O)cc2oc(-c3ccc(O)cc3)cc(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Thevetia peruviana  | Ref. |
| Plantae | Poaceae | Saccharum officinarum | Ref. |
|
|
zoom in
| Organism | Saccharum officinarum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Voigtlander, Arch.Pharm.,303,(1970),792
Misra, Indian J. Chem.,18,(1979),88 |
|---|
|
