Name |
Violaxanthin Violaxnathin |
Formula |
C40H56O4 |
Mw |
600.41786028 |
CAS RN |
126-29-4 |
C_ID |
C00003787
, 
|
InChIKey |
SZCBXWMUOPQSOX-QBPHOBMCNA-N |
InChICode |
InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-23-39-35(5,6)25-33(41)27-37(39,9)43-39)15-11-12-16-30(2)18-14-20-32(4)22-24-40-36(7,8)26-34(42)28-38(40,10)44-40/h11-24,33-34,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t33-,34-,37+,38+,39-,40-/m0/s1 |
SMILES |
[C@]12(/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(\C)/C=C/[C@]34C(C[C@@H](C[C@@]3(C)O4)O)(C)C)\C)/C)/C)C(C[C@@H](C[C@@]1(C)O2)O)(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Chromalveolata | Phaeodactylaceae | Phaeodactylum tricornutum | Ref. |
Chromista | Pelagomonadaceae | Aureococcus anaphagefferens | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
Plantae | Asteraceae | Calendula officinalis  | Ref. |
Plantae | Asteraceae | Tagetes patula  | Ref. |
Plantae | Asteraceae | Taraxacum officinale  | Ref. |
Plantae | Caricaceae | Carica papaya  | Ref. |
Plantae | Ceratophyllaceae | Ceratophyllum demersum  | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea  | Ref. |
Plantae | Cruciferae | Brassica rapa ssp. chinensis  | Ref. |
Plantae | Cruciferae | Raphanus sativus  | Ref. |
Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Labiatae | Ocimum basilicum  | Ref. |
Plantae | Orobanchaceae | Orobanche owerinii | Ref. |
Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
Plantae | Passifloraceae | Passiflora edulis  | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Polygonaceae | Rumex acetosa  | Ref. |
Plantae | Potamogetonaceae | Potamogeton perfoliatus  | Ref. |
Plantae | Rosaceae | Rosa foetida | Ref. |
Plantae | Rubiaceae | Coffea arabica  | Ref. |
Plantae | Rubiaceae | Coffea canephora  | Ref. |
Plantae | Rutaceae | Citrus limon  | Ref. |
Plantae | Rutaceae | Citrus limonia  | Ref. |
Plantae | Rutaceae | Citrus reticulata  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Solanaceae | Capsicum annuum  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Urticaceae | Urtica dioica  | Ref. |
Plantae | Violaceae | Viola tricolor  | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Thalassiosiria pseudonana | Ref. |
|
|
zoom in
Organism | Dioscorea bulbifera | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|