Name |
alpha-Carotene |
Formula |
C40H56 |
Mw |
536.43820179 |
CAS RN |
7488-99-5 |
C_ID |
C00003765
, 
|
InChIKey |
ANVAOWXLWRTKGA-BYORDMDQNA-N |
InChICode |
InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-23,25-28,37H,15-16,24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+/t37-/m0/s1 |
SMILES |
C1(=C(CCCC1(C)C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(\C)/C=C/[C@@H]1C(CCC=C1C)(C)C)\C)/C)/C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
-- | Rhodomelaceae | Polysiphonia brodiaei | Ref. |
-- | Rhodomelaceae | Polysiphonia urceolata | Ref. |
Plantae | Actinidiaceae | Actinidia chinensis  | Ref. |
Plantae | Actinidiaceae | Actinidia deliciosa  | Ref. |
Plantae | Actinidiaceae | Actinidia macrosperma | Ref. |
Plantae | Anacardiaceae | Mangifera indica  | Ref. |
Plantae | Apiaceae | Daucus carota  | Ref. |
Plantae | Aristolochiaceae | Ceramium rubrum | Ref. |
Plantae | Asparagaceae | Asparagus officinalis L.  | Ref. |
Plantae | Caricaceae | Carica papaya  | Ref. |
Plantae | Ceratophyllaceae | Ceratophyllum demersum  | Ref. |
Plantae | Corbiculidae | Corbicula japonica  | Ref. |
Plantae | Corbiculidae | Corbicula sandai  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea  | Ref. |
Plantae | Cruciferae | Brassica rapa ssp. chinensis  | Ref. |
Plantae | Cruciferae | Raphanus sativus  | Ref. |
Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
Plantae | Cucurbitaceae | Momordica cochinchinensis  | Ref. |
Plantae | Ebenaceae | Diospyros kaki  | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Palmae | Elaeis guineensis  | Ref. |
Plantae | Pandanaceae | Pandanus tectorius  | Ref. |
Plantae | Poaceae | Triticum aestivum  | Ref. |
Plantae | Poaceae | Zea mays  | Ref. |
Plantae | Rubiaceae | Coffea arabica  | Ref. |
Plantae | Rubiaceae | Coffea canephora  | Ref. |
Plantae | Rutaceae | Citrus sinensis  | Ref. |
Plantae | Solanaceae | Capsicum annuum  | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
- | - | Bangia fuscopurpurea | Ref. |
- | - | Bonnemaisonia hamifera | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Gigartina stellata | Ref. |
- | - | Nemalion helminthoides | Ref. |
- | - | Phodymenia palmata | Ref. |
|
|
zoom in
Organism | Capsicum annuum | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|