Name |
Taraxerol Alnulin Skimmiol Tiliadin |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
127-22-0 |
C_ID |
C00003758
,
|
InChIKey |
GGGUGZHBAOMSFJ-YXYDKRSONA-N |
InChICode |
InChI=1S/C30H50O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-24,31H,10-19H2,1-8H3/t20-,22+,23+,24-,27-,28-,29-,30+/m0/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)([C@@H]1[C@@](CC2)(C2=CC[C@@]3([C@H]([C@@]2(CC1)C)CC(CC3)(C)C)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Strobilanthes callosus | Ref. |
Plantae | Anacardiaceae | Mangifera persiciformis | Ref. |
Plantae | Annonaceae | Annona reticulata | Ref. |
Plantae | Araliaceae | Acanthopanax trifoliatus | Ref. |
Plantae | Asteraceae | Ageratina pichinchensis var. bustamenta | Ref. |
Plantae | Asteraceae | Launaea nudicaulis | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Asteraceae | Xanthium canadense Mill. | Ref. |
Plantae | Betulaceae | Alnus glutinosa | Ref. |
Plantae | Betulaceae | Alnus incana | Ref. |
Plantae | Burseraceae | Canarium spp. | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum bracteatum | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum cordato-oblongum | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum thwaitesii | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum trapezifolium | Ref. |
Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum walkeri | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis subglobosa | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen | Ref. |
Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
Plantae | Ebenaceae | Diospyros cordifolia | Ref. |
Plantae | Ebenaceae | Diospyros ferrea | Ref. |
Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros lotus | Ref. |
Plantae | Ebenaceae | Diospyros mollis | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros nicaraguensis | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ebenaceae | Diospyros spp. | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don. | Ref. |
Plantae | Euphorbiaceae | Euphorbia hirta | Ref. |
Plantae | Euphorbiaceae | Euphorbia indica | Ref. |
Plantae | Euphorbiaceae | Euphorbia myrsinites | Ref. |
Plantae | Euphorbiaceae | Excoecaria agallocha L. | Ref. |
Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
Plantae | Euphorbiaceae | Manihot esculenta | Ref. |
Plantae | Fabaceae | Dalbergia sericea | Ref. |
Plantae | Fagaceae | Lithocarpus spp. | Ref. |
Plantae | Jubulaceae | Frullania fugax | Ref. |
Plantae | Lauraceae | Litsea dealbata | Ref. |
Plantae | Lauraceae | Neolitsea konishii | Ref. |
Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
Plantae | Malvaceae | Tilia cordata Mill. | Ref. |
Plantae | Myricaceae | Myrica rubra | Ref. |
Plantae | Myrsinaceae | Embelia schimperi | Ref. |
Plantae | Ranunculaceae | Nigella sativa | Ref. |
Plantae | Rhamnaceae | Sageretia theezans | Ref. |
Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
Plantae | Rubiaceae | Hedyotis acutangula | Ref. |
Plantae | Rutaceae | Skimmia japonica | Ref. |
Plantae | Rutaceae | Skimmia wallachii | Ref. |
Plantae | Rutaceae | Vepris punctata | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Styracaceae | Styrax japonica | Ref. |
|
|
zoom in
Organism | Strobilanthes callosus | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|