Name |
Lupeol Lupenol (+)-Lupenol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
545-47-1 |
C_ID |
C00003749
,
|
InChIKey |
MQYXUWHLBZFQQO-ZAEXXZHRNA-N |
InChICode |
InChI=1S/C30H50O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21+,22-,23+,24-,25+,27+,28-,29+,30+/m0/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)([C@@H]1[C@@](CC2)([C@]2([C@H](CC1)[C@@H]1[C@](CC2)(C)CC[C@H]1C(=C)C)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Bombycidae | Bombyx mori | Ref. |
Fungi | Coprinaceae | Coprinus atramentarius | Ref. |
Plantae | Acanthaceae | Phlogacanthus curviflorus | Ref. |
Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
Plantae | Acanthaceae | Strobilanthes cusia BREMEK | Ref. |
Plantae | Acanthaceae | Strobilanthes formosanus | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apocynaceae | Alstonia boonei | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Hemidesmus indicus | Ref. |
Plantae | Apocynaceae | Periploca aphylla | Ref. |
Plantae | Apocynaceae | Thevetia peruviana | Ref. |
Plantae | Aquifoliaceae | Ilex cornuta | Ref. |
Plantae | Aquifoliaceae | Ilex latifolia | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis | Ref. |
Plantae | Asteraceae | Brachylaena ramiflora var. ramiflora | Ref. |
Plantae | Asteraceae | Centipeda minima | Ref. |
Plantae | Asteraceae | Chuquiraga ulicina ssp. ulicina | Ref. |
Plantae | Asteraceae | Cichorium intybus | Ref. |
Plantae | Asteraceae | Elephantopus scaber | Ref. |
Plantae | Asteraceae | Eupatorium macrocephalum Lee. | Ref. |
Plantae | Asteraceae | Launaea arborescens | Ref. |
Plantae | Asteraceae | Liatris laevigata | Ref. |
Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
Plantae | Asteraceae | Ligularia odontomanes | Ref. |
Plantae | Asteraceae | Ligularia sagitta | Ref. |
Plantae | Asteraceae | Petasites formosanus | Ref. |
Plantae | Asteraceae | Piptocarpha paradoxa | Ref. |
Plantae | Asteraceae | Saussurea lappa Clarke. | Ref. |
Plantae | Asteraceae | Scorzonera cretica | Ref. |
Plantae | Asteraceae | Senecio chionophilus | Ref. |
Plantae | Asteraceae | Sonchus arvensis | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Asteraceae | Vernonia erdverbengii | Ref. |
Plantae | Betulaceae | Betula platyphylla | Ref. |
Plantae | Boraginaceae | Arnebia hispidissima | Ref. |
Plantae | Boraginaceae | Arnebia nobilis | Ref. |
Plantae | Burseraceae | Bursera graveolens | Ref. |
Plantae | Burseraceae | Commiphora dalzielii | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Celastraceae | Maytenus cuzcoina | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia vilersiana | Ref. |
Plantae | Clusiaceae-Guttiferae | Allanblackia monticola Staner L.C | Ref. |
Plantae | Combretaceae | Pteleopsis hylodendron | Ref. |
Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
Plantae | Combretaceae | Terminalia superba | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Ebenaceae | Diospyros abyssinica | Ref. |
Plantae | Ebenaceae | Diospyros acuta | Ref. |
Plantae | Ebenaceae | Diospyros argentea | Ref. |
Plantae | Ebenaceae | Diospyros bipindensis | Ref. |
Plantae | Ebenaceae | Diospyros buxifolia | Ref. |
Plantae | Ebenaceae | Diospyros canaliculata | Ref. |
Plantae | Ebenaceae | Diospyros candalleana | Ref. |
Plantae | Ebenaceae | Diospyros castanea | Ref. |
Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
Plantae | Ebenaceae | Diospyros chevalieri | Ref. |
Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
Plantae | Ebenaceae | Diospyros consolatae | Ref. |
Plantae | Ebenaceae | Diospyros cordifolia | Ref. |
Plantae | Ebenaceae | Diospyros cornii | Ref. |
Plantae | Ebenaceae | Diospyros crassiflora | Ref. |
Plantae | Ebenaceae | Diospyros curranii | Ref. |
Plantae | Ebenaceae | Diospyros dendo | Ref. |
Plantae | Ebenaceae | Diospyros diepenhorstii | Ref. |
Plantae | Ebenaceae | Diospyros discolor | Ref. |
Plantae | Ebenaceae | Diospyros ebenum | Ref. |
Plantae | Ebenaceae | Diospyros ehretioides | Ref. |
Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
Plantae | Ebenaceae | Diospyros embryopteris | Ref. |
Plantae | Ebenaceae | Diospyros eriantha | Ref. |
Plantae | Ebenaceae | Diospyros evena | Ref. |
Plantae | Ebenaceae | Diospyros exsculpta | Ref. |
Plantae | Ebenaceae | Diospyros fragrans | Ref. |
Plantae | Ebenaceae | Diospyros gabunensis | Ref. |
Plantae | Ebenaceae | Diospyros gracilescens | Ref. |
Plantae | Ebenaceae | Diospyros greeniway | Ref. |
Plantae | Ebenaceae | Diospyros guianensis | Ref. |
Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
Plantae | Ebenaceae | Diospyros ismailii | Ref. |
Plantae | Ebenaceae | Diospyros iturensis | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros kaki var.sylvestris | Ref. |
Plantae | Ebenaceae | Diospyros kamerunensis | Ref. |
Plantae | Ebenaceae | Diospyros longiflora | Ref. |
Plantae | Ebenaceae | Diospyros lotus | Ref. |
Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
Plantae | Ebenaceae | Diospyros maingayi | Ref. |
Plantae | Ebenaceae | Diospyros mannii | Ref. |
Plantae | Ebenaceae | Diospyros maritima BLUME | Ref. |
Plantae | Ebenaceae | Diospyros melanoxylon | Ref. |
Plantae | Ebenaceae | Diospyros mespiliformis | Ref. |
Plantae | Ebenaceae | Diospyros monobuttensis | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros moonii | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros natalensis | Ref. |
Plantae | Ebenaceae | Diospyros obliquifolia | Ref. |
Plantae | Ebenaceae | Diospyros oppositifolia | Ref. |
Plantae | Ebenaceae | Diospyros peregrina | Ref. |
Plantae | Ebenaceae | Diospyros pseudo-malabarica | Ref. |
Plantae | Ebenaceae | Diospyros quaesita | Ref. |
Plantae | Ebenaceae | Diospyros rheophytica | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
Plantae | Ebenaceae | Diospyros siamang | Ref. |
Plantae | Ebenaceae | Diospyros siamensis | Ref. |
Plantae | Ebenaceae | Diospyros siderophylla | Ref. |
Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
Plantae | Ebenaceae | Diospyros spinescens | Ref. |
Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
Plantae | Ebenaceae | Diospyros tomentosa | Ref. |
Plantae | Ebenaceae | Diospyros toposia | Ref. |
Plantae | Ebenaceae | Diospyros virginiana | Ref. |
Plantae | Ebenaceae | Diospyros walkeri | Ref. |
Plantae | Ebenaceae | Diospyros wallichii | Ref. |
Plantae | Ebenaceae | Diospyros zenkeri | Ref. |
Plantae | Ebenaceae | Euclea divinorum | Ref. |
Plantae | Ebenaceae | Euclea natalensis | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Epigaea asiatica | Ref. |
Plantae | Ericaceae | Erica arborea L. | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don. | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ovalifolium | Ref. |
Plantae | Erythroxylaceae | Erythroxylum passerinum | Ref. |
Plantae | Euphorbiaceae | Croton zambesicus | Ref. |
Plantae | Euphorbiaceae | Euphorbia helioscopia | Ref. |
Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
Plantae | Euphorbiaceae | Euphorbia portlandica | Ref. |
Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
Plantae | Euphorbiaceae | Euphorbia tanquahuete | Ref. |
Plantae | Euphorbiaceae | Pedilanthus tithymaloides | Ref. |
Plantae | Euphorbiaceae | Ricinus communis | Ref. |
Plantae | Fabaceae | Acacia mellifera | Ref. |
Plantae | Fabaceae | Acacia pennatula | Ref. |
Plantae | Fabaceae | Acacia trineura | Ref. |
Plantae | Fabaceae | Albizia gummifera | Ref. |
Plantae | Fabaceae | Albizia lebbeck | Ref. |
Plantae | Fabaceae | Albizia versicolor | Ref. |
Plantae | Fabaceae | Anadenanthera colubrine | Ref. |
Plantae | Fabaceae | Caesalpinia decapetala | Ref. |
Plantae | Fabaceae | Caesalpinia pulcherrima | Ref. |
Plantae | Fabaceae | Cassia siamea Lamk. | Ref. |
Plantae | Fabaceae | Cassia speciosa | Ref. |
Plantae | Fabaceae | Crotalaria assamica | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Deguelia hatschbachii | Ref. |
Plantae | Fabaceae | Derris oblonga | Ref. |
Plantae | Fabaceae | Entada scandens | Ref. |
Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Lupinus luteus | Ref. |
Plantae | Fabaceae | Millettia pinnata | Ref. |
Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Pongamia pinnata | Ref. |
Plantae | Fabaceae | Pterocarpus santalinus | Ref. |
Plantae | Fabaceae | Sophora subprostrata | Ref. |
Plantae | Fabaceae | Sophora substrata | Ref. |
Plantae | Fabaceae | Tephrosia purpurea | Ref. |
Plantae | Fagaceae | Quercus myrsenaefolia | Ref. |
Plantae | Fagaceae | Quercus stenophylla Makino. | Ref. |
Plantae | Gentianaceae | Gentiana lutea | Ref. |
Plantae | Gentianaceae | Gentiana scabra | Ref. |
Plantae | Hypericaceae | Harungana madagascariensis | Ref. |
Plantae | Icacinaceae | Gonocaryum calleryanum | Ref. |
Plantae | Labiatae | Marsypianthes chamaedrys | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia roborowskii | Ref. |
Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
Plantae | Lauraceae | Beilschmiedia erythrophloia | Ref. |
Plantae | Lauraceae | Neolitsea konishii | Ref. |
Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
Plantae | Longaniaceae | Strychnos potatorum | Ref. |
Plantae | Loranthaceae | Loranthus parasiticus | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Malpighiaceae | Byrsonima microphylla | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Malvaceae | Adansonia digitata | Ref. |
Plantae | Malvaceae | Eriolaena hookeriana | Ref. |
Plantae | Meliaceae | Aglaia forbesii | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Meliaceae | Dysoxylum malabaricum | Ref. |
Plantae | Melianthaceae | Bersama swinyi | Ref. |
Plantae | Moraceae | Dorstenia angusticornis | Ref. |
Plantae | Moraceae | Ficus carica | Ref. |
Plantae | Moraceae | Ficus microcarpa | Ref. |
Plantae | Moraceae | Ficus rasemosa | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myricaceae | Myrica rubra | Ref. |
Plantae | Myrtaceae | Rhodomyrtus tomentosa | Ref. |
Plantae | Myrtaceae | Syzygium formosanum | Ref. |
Plantae | Oleaceae | Nyctanthes arbor-tristis Linn. | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Oleaceae | Phillyrea latifolia L. | Ref. |
Plantae | Phyllanthaceae | Glochidion eriocarpum | Ref. |
Plantae | Phyllanthaceae | Glochidion puberum | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Phyllanthaceae | Phyllanthus flexuosus | Ref. |
Plantae | Plantaginaceae | Scoparia dulcis L. | Ref. |
Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
Plantae | Polygonaceae | Rumex nepalensis | Ref. |
Plantae | Putranjivaceae | Drypetes tessmanniana | Ref. |
Plantae | Rhamnaceae | Alphitonia petriei Braid et White. | Ref. |
Plantae | Rhamnaceae | Rhamnus wightii | Ref. |
Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
Plantae | Rhizophoraceae | Bruguiera gymnorrhiza | Ref. |
Plantae | Rhizophoraceae | Bruguiera parviflora | Ref. |
Plantae | Rhizophoraceae | Ceriops tagal | Ref. |
Plantae | Rubiaceae | Coussarea paniculata | Ref. |
Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Esenbeckia yaxhoob Lundell | Ref. |
Plantae | Rutaceae | Fagara heitzii | Ref. |
Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
Plantae | Rutaceae | Luvunga sarmentosa (Bl.) Kurz. | Ref. |
Plantae | Rutaceae | Oricia gabonensis | Ref. |
Plantae | Rutaceae | Oricia suaveolens | Ref. |
Plantae | Rutaceae | Vepris punctata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Rutaceae | Zanthoxylum culantrillo | Ref. |
Plantae | Rutaceae | Zanthoxylum dipetalum | Ref. |
Plantae | Salicaceae | Populus tremula L. | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Sapindaceae | Schleichera oleosa | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala | Ref. |
Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense | Ref. |
Plantae | Verbenaceae | Verbena officinalis L. | Ref. |
- | - | Aegopordon berarioides | Ref. |
- | - | Asteracantha longifolia | Ref. |
- | - | Baphicacanthus cusia | Ref. |
- | - | Befaria glutinosa | Ref. |
- | - | Crataeva benthami | Ref. |
- | - | Crotone hieronymi | Ref. |
- | - | Hypestes purpurea | Ref. |
- | - | Laurencia dendroidea | Ref. |
- | - | Moghania macrophylla | Ref. |
- | - | Tevenotica persica | Ref. |
- | - | Zizphus cambodiana | Ref. |
|
|
zoom in
Organism | Terminalia brasiliensis | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|