Name |
Lupeol Lupenol (+)-Lupenol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
545-47-1 |
C_ID |
C00003749
,
|
InChIKey |
MQYXUWHLBZFQQO-ZAEXXZHRNA-N |
InChICode |
InChI=1S/C30H50O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21+,22-,23+,24-,25+,27+,28-,29+,30+/m0/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)([C@@H]1[C@@](CC2)([C@]2([C@H](CC1)[C@@H]1[C@](CC2)(C)CC[C@H]1C(=C)C)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Bombycidae | Bombyx mori | Ref. |
Fungi | Coprinaceae | Coprinus atramentarius | Ref. |
Plantae | Acanthaceae | Phlogacanthus curviflorus | Ref. |
Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
Plantae | Acanthaceae | Strobilanthes cusia BREMEK | Ref. |
Plantae | Acanthaceae | Strobilanthes formosanus | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Apocynaceae | Alstonia boonei | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Hemidesmus indicus | Ref. |
Plantae | Apocynaceae | Periploca aphylla | Ref. |
Plantae | Apocynaceae | Thevetia peruviana | Ref. |
Plantae | Aquifoliaceae | Ilex cornuta | Ref. |
Plantae | Aquifoliaceae | Ilex latifolia | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis | Ref. |
Plantae | Asteraceae | Brachylaena ramiflora var. ramiflora | Ref. |
Plantae | Asteraceae | Centipeda minima | Ref. |
Plantae | Asteraceae | Chuquiraga ulicina ssp. ulicina | Ref. |
Plantae | Asteraceae | Cichorium intybus | Ref. |
Plantae | Asteraceae | Elephantopus scaber | Ref. |
Plantae | Asteraceae | Eupatorium macrocephalum Lee. | Ref. |
Plantae | Asteraceae | Launaea arborescens | Ref. |
Plantae | Asteraceae | Liatris laevigata | Ref. |
Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
Plantae | Asteraceae | Ligularia odontomanes | Ref. |
Plantae | Asteraceae | Ligularia sagitta | Ref. |
Plantae | Asteraceae | Petasites formosanus | Ref. |
Plantae | Asteraceae | Piptocarpha paradoxa | Ref. |
Plantae | Asteraceae | Saussurea lappa Clarke. | Ref. |
Plantae | Asteraceae | Scorzonera cretica | Ref. |
Plantae | Asteraceae | Senecio chionophilus | Ref. |
Plantae | Asteraceae | Sonchus arvensis | Ref. |
Plantae | Asteraceae | Taraxacum officinale | Ref. |
Plantae | Asteraceae | Vernonia erdverbengii | Ref. |
Plantae | Betulaceae | Betula platyphylla | Ref. |
Plantae | Boraginaceae | Arnebia hispidissima | Ref. |
Plantae | Boraginaceae | Arnebia nobilis | Ref. |
Plantae | Burseraceae | Bursera graveolens | Ref. |
Plantae | Burseraceae | Commiphora dalzielii | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Celastraceae | Maytenus cuzcoina | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ | Ref. |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia vilersiana | Ref. |
Plantae | Clusiaceae-Guttiferae | Allanblackia monticola Staner L.C | Ref. |
Plantae | Combretaceae | Pteleopsis hylodendron | Ref. |
Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
Plantae | Combretaceae | Terminalia superba | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Ebenaceae | Diospyros abyssinica | Ref. |
Plantae | Ebenaceae | Diospyros acuta | Ref. |
Plantae | Ebenaceae | Diospyros argentea | Ref. |
Plantae | Ebenaceae | Diospyros bipindensis | Ref. |
Plantae | Ebenaceae | Diospyros buxifolia | Ref. |
Plantae | Ebenaceae | Diospyros canaliculata | Ref. |
Plantae | Ebenaceae | Diospyros candalleana | Ref. |
Plantae | Ebenaceae | Diospyros castanea | Ref. |
Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
Plantae | Ebenaceae | Diospyros chevalieri | Ref. |
Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
Plantae | Ebenaceae | Diospyros consolatae | Ref. |
Plantae | Ebenaceae | Diospyros cordifolia | Ref. |
Plantae | Ebenaceae | Diospyros cornii | Ref. |
Plantae | Ebenaceae | Diospyros crassiflora | Ref. |
Plantae | Ebenaceae | Diospyros curranii | Ref. |
Plantae | Ebenaceae | Diospyros dendo | Ref. |
Plantae | Ebenaceae | Diospyros diepenhorstii | Ref. |
Plantae | Ebenaceae | Diospyros discolor | Ref. |
Plantae | Ebenaceae | Diospyros ebenum | Ref. |
Plantae | Ebenaceae | Diospyros ehretioides | Ref. |
Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
Plantae | Ebenaceae | Diospyros embryopteris | Ref. |
Plantae | Ebenaceae | Diospyros eriantha | Ref. |
Plantae | Ebenaceae | Diospyros evena | Ref. |
Plantae | Ebenaceae | Diospyros exsculpta | Ref. |
Plantae | Ebenaceae | Diospyros fragrans | Ref. |
Plantae | Ebenaceae | Diospyros gabunensis | Ref. |
Plantae | Ebenaceae | Diospyros gracilescens | Ref. |
Plantae | Ebenaceae | Diospyros greeniway | Ref. |
Plantae | Ebenaceae | Diospyros guianensis | Ref. |
Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
Plantae | Ebenaceae | Diospyros ismailii | Ref. |
Plantae | Ebenaceae | Diospyros iturensis | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros kaki var.sylvestris | Ref. |
Plantae | Ebenaceae | Diospyros kamerunensis | Ref. |
Plantae | Ebenaceae | Diospyros longiflora | Ref. |
Plantae | Ebenaceae | Diospyros lotus | Ref. |
Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
Plantae | Ebenaceae | Diospyros maingayi | Ref. |
Plantae | Ebenaceae | Diospyros mannii | Ref. |
Plantae | Ebenaceae | Diospyros maritima BLUME | Ref. |
Plantae | Ebenaceae | Diospyros melanoxylon | Ref. |
Plantae | Ebenaceae | Diospyros mespiliformis | Ref. |
Plantae | Ebenaceae | Diospyros monobuttensis | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros moonii | Ref. |
Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
Plantae | Ebenaceae | Diospyros natalensis | Ref. |
Plantae | Ebenaceae | Diospyros obliquifolia | Ref. |
Plantae | Ebenaceae | Diospyros oppositifolia | Ref. |
Plantae | Ebenaceae | Diospyros peregrina | Ref. |
Plantae | Ebenaceae | Diospyros pseudo-malabarica | Ref. |
Plantae | Ebenaceae | Diospyros quaesita | Ref. |
Plantae | Ebenaceae | Diospyros rheophytica | Ref. |
Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
Plantae | Ebenaceae | Diospyros siamang | Ref. |
Plantae | Ebenaceae | Diospyros siamensis | Ref. |
Plantae | Ebenaceae | Diospyros siderophylla | Ref. |
Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
Plantae | Ebenaceae | Diospyros spinescens | Ref. |
Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
Plantae | Ebenaceae | Diospyros tomentosa | Ref. |
Plantae | Ebenaceae | Diospyros toposia | Ref. |
Plantae | Ebenaceae | Diospyros virginiana | Ref. |
Plantae | Ebenaceae | Diospyros walkeri | Ref. |
Plantae | Ebenaceae | Diospyros wallichii | Ref. |
Plantae | Ebenaceae | Diospyros zenkeri | Ref. |
Plantae | Ebenaceae | Euclea divinorum | Ref. |
Plantae | Ebenaceae | Euclea natalensis | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Epigaea asiatica | Ref. |
Plantae | Ericaceae | Erica arborea L. | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don. | Ref. |
Plantae | Erythroxylaceae | Erythroxylum ovalifolium | Ref. |
Plantae | Erythroxylaceae | Erythroxylum passerinum | Ref. |
Plantae | Euphorbiaceae | Croton zambesicus | Ref. |
Plantae | Euphorbiaceae | Euphorbia helioscopia | Ref. |
Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
Plantae | Euphorbiaceae | Euphorbia portlandica | Ref. |
Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
Plantae | Euphorbiaceae | Euphorbia tanquahuete | Ref. |
Plantae | Euphorbiaceae | Pedilanthus tithymaloides | Ref. |
Plantae | Euphorbiaceae | Ricinus communis | Ref. |
Plantae | Fabaceae | Acacia mellifera | Ref. |
Plantae | Fabaceae | Acacia pennatula | Ref. |
Plantae | Fabaceae | Acacia trineura | Ref. |
Plantae | Fabaceae | Albizia gummifera | Ref. |
Plantae | Fabaceae | Albizia lebbeck | Ref. |
Plantae | Fabaceae | Albizia versicolor | Ref. |
Plantae | Fabaceae | Anadenanthera colubrine | Ref. |
Plantae | Fabaceae | Caesalpinia decapetala | Ref. |
Plantae | Fabaceae | Caesalpinia pulcherrima | Ref. |
Plantae | Fabaceae | Cassia siamea Lamk. | Ref. |
Plantae | Fabaceae | Cassia speciosa | Ref. |
Plantae | Fabaceae | Crotalaria assamica | Ref. |
Plantae | Fabaceae | Crotalaria pallida | Ref. |
Plantae | Fabaceae | Deguelia hatschbachii | Ref. |
Plantae | Fabaceae | Derris oblonga | Ref. |
Plantae | Fabaceae | Entada scandens | Ref. |
Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Lupinus luteus | Ref. |
Plantae | Fabaceae | Millettia pinnata | Ref. |
Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Pongamia pinnata | Ref. |
Plantae | Fabaceae | Pterocarpus santalinus | Ref. |
Plantae | Fabaceae | Sophora subprostrata | Ref. |
Plantae | Fabaceae | Sophora substrata | Ref. |
Plantae | Fabaceae | Tephrosia purpurea | Ref. |
Plantae | Fagaceae | Quercus myrsenaefolia | Ref. |
Plantae | Fagaceae | Quercus stenophylla Makino. | Ref. |
Plantae | Gentianaceae | Gentiana lutea | Ref. |
Plantae | Gentianaceae | Gentiana scabra | Ref. |
Plantae | Hypericaceae | Harungana madagascariensis | Ref. |
Plantae | Icacinaceae | Gonocaryum calleryanum | Ref. |
Plantae | Labiatae | Marsypianthes chamaedrys | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia roborowskii | Ref. |
Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
Plantae | Lauraceae | Beilschmiedia erythrophloia | Ref. |
Plantae | Lauraceae | Neolitsea konishii | Ref. |
Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
Plantae | Longaniaceae | Strychnos potatorum | Ref. |
Plantae | Loranthaceae | Loranthus parasiticus | Ref. |
Plantae | Lythraceae | Lawsonia alba | Ref. |
Plantae | Malpighiaceae | Byrsonima microphylla | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Malvaceae | Adansonia digitata | Ref. |
Plantae | Malvaceae | Eriolaena hookeriana | Ref. |
Plantae | Meliaceae | Aglaia forbesii | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Meliaceae | Dysoxylum malabaricum | Ref. |
Plantae | Melianthaceae | Bersama swinyi | Ref. |
Plantae | Moraceae | Dorstenia angusticornis | Ref. |
Plantae | Moraceae | Ficus carica | Ref. |
Plantae | Moraceae | Ficus microcarpa | Ref. |
Plantae | Moraceae | Ficus rasemosa | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myricaceae | Myrica rubra | Ref. |
Plantae | Myrtaceae | Rhodomyrtus tomentosa | Ref. |
Plantae | Myrtaceae | Syzygium formosanum | Ref. |
Plantae | Oleaceae | Nyctanthes arbor-tristis Linn. | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Oleaceae | Phillyrea latifolia L. | Ref. |
Plantae | Phyllanthaceae | Glochidion eriocarpum | Ref. |
Plantae | Phyllanthaceae | Glochidion puberum | Ref. |
Plantae | Phyllanthaceae | Phyllanthus emblica | Ref. |
Plantae | Phyllanthaceae | Phyllanthus flexuosus | Ref. |
Plantae | Plantaginaceae | Scoparia dulcis L. | Ref. |
Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
Plantae | Polygonaceae | Rumex nepalensis | Ref. |
Plantae | Putranjivaceae | Drypetes tessmanniana | Ref. |
Plantae | Rhamnaceae | Alphitonia petriei Braid et White. | Ref. |
Plantae | Rhamnaceae | Rhamnus wightii | Ref. |
Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
Plantae | Rhizophoraceae | Bruguiera gymnorrhiza | Ref. |
Plantae | Rhizophoraceae | Bruguiera parviflora | Ref. |
Plantae | Rhizophoraceae | Ceriops tagal | Ref. |
Plantae | Rubiaceae | Coussarea paniculata | Ref. |
Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
Plantae | Rutaceae | Aegle marmelos | Ref. |
Plantae | Rutaceae | Esenbeckia yaxhoob Lundell | Ref. |
Plantae | Rutaceae | Fagara heitzii | Ref. |
Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
Plantae | Rutaceae | Luvunga sarmentosa (Bl.) Kurz. | Ref. |
Plantae | Rutaceae | Oricia gabonensis | Ref. |
Plantae | Rutaceae | Oricia suaveolens | Ref. |
Plantae | Rutaceae | Vepris punctata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Rutaceae | Zanthoxylum culantrillo | Ref. |
Plantae | Rutaceae | Zanthoxylum dipetalum | Ref. |
Plantae | Salicaceae | Populus tremula L. | Ref. |
Plantae | Santalaceae | Viscum coloratum | Ref. |
Plantae | Sapindaceae | Schleichera oleosa | Ref. |
Plantae | Solanaceae | Lycium chinense | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala | Ref. |
Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense | Ref. |
Plantae | Verbenaceae | Verbena officinalis L. | Ref. |
- | - | Aegopordon berarioides | Ref. |
- | - | Asteracantha longifolia | Ref. |
- | - | Baphicacanthus cusia | Ref. |
- | - | Befaria glutinosa | Ref. |
- | - | Crataeva benthami | Ref. |
- | - | Crotone hieronymi | Ref. |
- | - | Hypestes purpurea | Ref. |
- | - | Laurencia dendroidea | Ref. |
- | - | Moghania macrophylla | Ref. |
- | - | Tevenotica persica | Ref. |
- | - | Zizphus cambodiana | Ref. |
|
|
zoom in
Organism | Bruguiera parviflora | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Wang, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 29, (1994), 268.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wu, et al., Phytochemistry, 52, (1999), 901.
Chumkaew, et al., Chem Pharm Bull, 53, (2005), 95.
Tanaka, et al., Chem Pharm Bull, 52, (2004), 1242.
Mutai, et al., Phytochemistry, 65, (2004), 1159.
Tanaka, et al., Planta Med, 70, (2004), 1234.
TORIUMI, et al., Chem Pharm Bull, 51, (2003), 89.
Calixto, et al., Planta Med, 69, (2003), 973.
NAKANISHI, et al., Chem Pharm Bull, 53, (2005), 229.
KIEM, et al., Chem Pharm Bull, 53, (2005), 428.
Gutierrez-Lugo, et al., Planta Med, 70, (2004), 263.
Madureira, et al., Planta Med, 70, (2004), 828.
Puapairoj, et al., Planta Med, 71, (2005), 208.
Li, et al., Planta Med, 69, (2003), 356.
Chaaib, et al., Planta Med, 69, (2003), 316 |
---|
|