Name |
alpha-Amyrin alpha-Amyrine alpha-Amyrenol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
638-95-9 |
C_ID |
C00003737
,
|
InChIKey |
SGYDZCYMKXFTKG-ATMISIKVNA-N |
InChICode |
InChI=1S/C30H50O/c1-19-11-14-27(5)17-18-29(7)21(25(27)20(19)2)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h9-10,19-25,31H,11-18H2,1-8H3/t19-,20+,21-,22-,23-,24+,25-,27-,28+,29-,30-/m1/s1 |
SMILES |
C1[C@@H](C([C@@H]2[C@](C1)([C@@H]1[C@@](CC2)([C@]2([C@H](C=C1)[C@@H]1[C@@](CC2)(CC[C@H]([C@@H]1C)C)C)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Acanthaceae | Adhatoda vasica | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Apiaceae | Angelica archangelica | Ref. |
Plantae | Apocynaceae | Alstonia boonei | Ref. |
Plantae | Apocynaceae | Calotropis gigantea | Ref. |
Plantae | Apocynaceae | Catharanthus roseus | Ref. |
Plantae | Apocynaceae | Hemidesmus indicus | Ref. |
Plantae | Apocynaceae | Solenostemma argel | Ref. |
Plantae | Apocynaceae | Thevetia peruviana | Ref. |
Plantae | Aquifoliaceae | Ilex asprella | Ref. |
Plantae | Aquifoliaceae | Ilex pubescens | Ref. |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asteraceae | Achillea alexandri-regis Bornm.& Rudski | Ref. |
Plantae | Asteraceae | Ajania fruticulosa | Ref. |
Plantae | Asteraceae | Artemisia vulgaris | Ref. |
Plantae | Asteraceae | Centaurea cineraria L. | Ref. |
Plantae | Asteraceae | Eupatorium macrocephalum Lee. | Ref. |
Plantae | Asteraceae | Inula cappa | Ref. |
Plantae | Asteraceae | Senecio chionophilus | Ref. |
Plantae | Asteraceae | Senecio viravira | Ref. |
Plantae | Asteraceae | Sonchus arvensis | Ref. |
Plantae | Balanophoraceae | Balanophora elongata | Ref. |
Plantae | Boraginaceae | Ehretia buxifolia | Ref. |
Plantae | Buddlejaceae | Buddleja madagascariensis | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Celastraceae | Tripterygium wilfordii | Ref. |
Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Brassica rapa | Ref. |
Plantae | Ebenaceae | Diospyros cordifolia | Ref. |
Plantae | Ebenaceae | Diospyros cornii | Ref. |
Plantae | Ebenaceae | Diospyros ebenum | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Ebenaceae | Diospyros kirkii | Ref. |
Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
Plantae | Ebenaceae | Diospyros maingayi | Ref. |
Plantae | Ebenaceae | Diospyros melanoxylon | Ref. |
Plantae | Ebenaceae | Diospyros mespiliformis | Ref. |
Plantae | Ebenaceae | Diospyros montana | Ref. |
Plantae | Ebenaceae | Diospyros natalensis | Ref. |
Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
Plantae | Ericaceae | Enkianthus cernuus | Ref. |
Plantae | Ericaceae | Epigaea asiatica | Ref. |
Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
Plantae | Ericaceae | Pieris japonica D.Don. | Ref. |
Plantae | Erythroxylaceae | Erythroxylum coca | Ref. |
Plantae | Erythroxylaceae | Erythroxylum rimosum | Ref. |
Plantae | Euphorbiaceae | Croton zambesicus | Ref. |
Plantae | Euphorbiaceae | Euphorbia hirta | Ref. |
Plantae | Fabaceae | Albizia lebbeck | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Gentianaceae | Gentiana lutea | Ref. |
Plantae | Gentianaceae | Gentiana scabra | Ref. |
Plantae | Gentianaceae | Gentiana straminea | Ref. |
Plantae | Icacinaceae | Gonocaryum calleryanum | Ref. |
Plantae | Iridaceae | Iris germanica L. | Ref. |
Plantae | Labiatae | Lavandula canariensis | Ref. |
Plantae | Labiatae | Marsypianthes chamaedrys | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Labiatae | Sideritis kuegleriana | Ref. |
Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
Plantae | Labiatae | Sideritis tenoi | Ref. |
Plantae | Linaceae | Linum scabrellum | Ref. |
Plantae | Longaniaceae | Strychnos potatorum | Ref. |
Plantae | Malvaceae | Eriolaena hookeriana | Ref. |
Plantae | Malvaceae | Malva parviflora | Ref. |
Plantae | Moraceae | Ficus variegata | Ref. |
Plantae | Moraceae | Morus alba | Ref. |
Plantae | Moringaceae | Moringa oleifera | Ref. |
Plantae | Moringaceae | Moringa peregrina | Ref. |
Plantae | Moringaceae | Moringa peregrine | Ref. |
Plantae | Moringaceae | Moringa stenopetala | Ref. |
Plantae | Myrsinaceae | Ardisia solanacea | Ref. |
Plantae | Oleaceae | Olea europaea | Ref. |
Plantae | Plumbaginaceae | Plumbago zeylanica | Ref. |
Plantae | Rosaceae | Prunus avium | Ref. |
Plantae | Rubiaceae | Chiococca alba | Ref. |
Plantae | Rubiaceae | Psychotria adenophylla | Ref. |
Plantae | Rutaceae | Dictamnus hispanicus | Ref. |
Plantae | Rutaceae | Vepris punctata | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Salicaceae | Populus tremula L. | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Verbenaceae | Duranta plumieri | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Crotone hieronymi | Ref. |
- | - | Decalepsis hamiltonii | Ref. |
- | - | Moghania macrophylla | Ref. |
- | - | Protium heptaphylum | Ref. |
- | - | Tevenotica persica | Ref. |
|
|
zoom in
Organism | Moringa stenopetala | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|