Name |
Spinasterol alpha-Spinasterin alpha-Spinasterol (-)-Spinasterol |
Formula |
C29H48O |
Mw |
412.37051615 |
CAS RN |
481-18-5 |
C_ID |
C00003673
,
|
InChIKey |
JZVFJDZBLUFKCA-BIZAHVARNA-N |
InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,11,19-23,25-27,30H,7,10,12-18H2,1-6H3/b9-8+/t20-,21+,22-,23-,25+,26-,27-,28-,29+/m0/s1 |
SMILES |
C1[C@@H](C[C@H]2[C@](C1)([C@@H]1C(=CC2)[C@H]2[C@](CC1)([C@H](CC2)[C@H](/C=C/[C@H](C(C)C)CC)C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Amaranthaceae | Achyranthes aspera | Ref. |
Plantae | Amaranthaceae | Achyranthes bidentata | Ref. |
Plantae | Apiaceae | Bupleurum aureum | Ref. |
Plantae | Apiaceae | Bupleurum chinense | Ref. |
Plantae | Apiaceae | Bupleurum longiradiatum | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Aster scaber | Ref. |
Plantae | Asteraceae | Conyza blinii | Ref. |
Plantae | Asteraceae | Eupatorium macrocephalum Lee. | Ref. |
Plantae | Balsaminaceae | Impatiens siculifer | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Platycodon grandiflorum | Ref. |
Plantae | Caryophyllaceae | Drymaria cordata | Ref. |
Plantae | Caryophyllaceae | Gypsophila struthium | Ref. |
Plantae | Chenopodiaceae | Spinacia oleracea | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Citrullus colocynthis | Ref. |
Plantae | Cucurbitaceae | Cucumis sativus | Ref. |
Plantae | Cucurbitaceae | Luffa cylindrica | Ref. |
Plantae | Cucurbitaceae | Trichosanthes cucumeroides | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Ericaceae | Kalmia latifolia L. | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba L. | Ref. |
Plantae | Hydrocharitaceae | Vallisneria spiralis | Ref. |
Plantae | Malvaceae | Hibiscus sabdariffa L. | Ref. |
Plantae | Menyanthaceae | Menyanthes trifoliata | Ref. |
Plantae | Myrsinaceae | Embelia parviflora | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Papaveraceae | Chelidonium ambrosioides | Ref. |
Plantae | Papaveraceae | Chelidonium majus | Ref. |
Plantae | Phytolaccaceae | Phytolacca americana | Ref. |
Plantae | Polygalaceae | Polygala senega | Ref. |
Plantae | Scrophulariaceae | Scrophularia takesimensis | Ref. |
Plantae | Verbenaceae | Clerodendron serratum | Ref. |
|
|
zoom in
Organism | Ageratina conyzoides | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|