Name |
24-Methylenecycloartan-3beta-ol 24-Methylenecycloartanol |
Formula |
C31H52O |
Mw |
440.40181628 |
CAS RN |
1449-09-8 |
C_ID |
C00003661
, 
|
InChIKey |
BDHQMRXFDYJGII-YOOBTQKONA-N |
InChICode |
InChI=1S/C31H52O/c1-20(2)21(3)9-10-22(4)23-13-15-29(8)25-12-11-24-27(5,6)26(32)14-16-30(24)19-31(25,30)18-17-28(23,29)7/h20,22-26,32H,3,9-19H2,1-2,4-8H3/t22-,23-,24+,25+,26+,28-,29+,30-,31+/m1/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@]3(C1)[C@]1([C@@H](CC2)[C@]2([C@](CC1)([C@H](CC2)[C@@H](CCC(=C)C(C)C)C)C)C)C3)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
Plantae | Euphorbiaceae | Euphorbia peplus  | Ref. |
Plantae | Euphorbiaceae | Euphorbia segetalis  | Ref. |
Plantae | Fabaceae | Glycine max  | Ref. |
Plantae | Fabaceae | Pisum sativum  | Ref. |
Plantae | Labiatae | Salvia breviflora | Ref. |
Plantae | Labiatae | Salvia nemorosa | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Moraceae | Ficus carica  | Ref. |
Plantae | Pinaceae | Larix kaempferi (Lamb.) Carr | Ref. |
Plantae | Poaceae | Oryza sativa  | Ref. |
Plantae | Ranunculaceae | Nigella sativa  | Ref. |
Plantae | Rutaceae | Phellodendron amurense  | Ref. |
Plantae | Solanaceae | Solanum chacoense Bitt. | Ref. |
Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
Plantae | Solanaceae | Solanum tuberosum  | Ref. |
Plantae | Typhaceae/Sparganiaceae | Sparganium stoloniferum | Ref. |
- | - | Caffea sp. | Ref. |
|
|
zoom in
Organism | Salvia breviflora | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|