Name |
Lanosterol Lanosta-8,24-dien-3beta-ol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
79-63-0 |
C_ID |
C00003657
, 
|
InChIKey |
CAHGCLMLTWQZNJ-STXVIIJTNA-N |
InChICode |
InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
SMILES |
C1[C@@H](C([C@H]2[C@](C1)(C1=C(CC2)[C@]2([C@](CC1)([C@H](CC2)[C@@H](CCC=C(C)C)C)C)C)C)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Amoebozoa | Physaridae | Physarum flavicomum | Ref. |
Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
Fungi | Agaricaceae | Agaricus campestris  | Ref. |
Fungi | Blastocladiaceae | Allomyces macrogynus | Ref. |
Fungi | Dothideomycetes | Alternaria kikuchiana | Ref. |
Fungi | Fomitopsidaceae | Fomitopsis pinicola  | Ref. |
Fungi | Meripilaceae | Grifola frondosa  | Ref. |
Fungi | Mucoraceae | Mucor pusillus | Ref. |
Fungi | Nectriaceae | Gibberella fujikuroi | Ref. |
Fungi | Phycomycetaceae | Phycomyces blakesleeanus | Ref. |
Fungi | Polyporaceae | Coriolus heteromorphus | Ref. |
Fungi | Polyporaceae | Coriolus pargamenus | Ref. |
Fungi | Polyporaceae | Fomes officinalis | Ref. |
Fungi | Polyporaceae | Microporus labelliformis | Ref. |
Fungi | Pucciniaceae | Uromyces phaseoli | Ref. |
Fungi | Saccharomycetaceae | Candida albicans | Ref. |
Fungi | Saccharomycetaceae | Candida utilis | Ref. |
Fungi | Saccharomycetaceae | Pichia sp. | Ref. |
Fungi | Saccharomycetaceae | Saccharomyces cerevisiae  | Ref. |
Fungi | Saccharomycetaceae | Torulopsis glabrata | Ref. |
Fungi | Sordariaceae | Neurospora crassa | Ref. |
Fungi | Trichocomaceae | Aspergillus oryzae | Ref. |
Plantae | Anacardiaceae | Lannea grandis | Ref. |
Plantae | Araliaceae | Panax ginseng  | Ref. |
Plantae | Chytridium | Chytridium confervae | Ref. |
Plantae | Costaceae | Costus speciosus  | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Dioscoreaceae | Dioscorea deltoidea  | Ref. |
Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
Plantae | Euphorbiaceae | Euphorbia peplus  | Ref. |
Plantae | Euphorbiaceae | Euphorbia pulcherrima | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Nitrariaceae | Peganum harmala  | Ref. |
Plantae | Oleaceae | Olea europaea  | Ref. |
Plantae | Solanaceae | Capsicum annuum L.  | Ref. |
Plantae | Solanaceae | Lycium chinense  | Ref. |
Plantae | Solanaceae | Physalis alkekengi var.franchetii  | Ref. |
Plantae | Solanaceae | Solanum indicum  | Ref. |
Plantae | Solanaceae | Solanum melongena  | Ref. |
- | - | Blastocladia ramosa | Ref. |
- | - | Blastocladiella emersonii | Ref. |
- | - | Catenaria anguillulae | Ref. |
- | - | Cryptoderma citrinum | Ref. |
- | - | Hymenomycetes sp. | Ref. |
- | - | Hyphochytrium catenoides | Ref. |
- | - | Rhizidiomyces apophysatus | Ref. |
- | - | Rhyzophlyctis rosea | Ref. |
- | - | Spizellomyces punctatum | Ref. |
- | - | Ustilago maydis  | Ref. |
|
|
zoom in
Organism | Solanum indicum | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
---|
|