Name |
Fucosterol (24R)24-Ethylcholesta-5,24(28)-dien-3beta-ol |
Formula |
C29H48O |
Mw |
412.37051615 |
CAS RN |
17605-67-3 |
C_ID |
C00003653
,
|
InChIKey |
OSELKOCHBMDKEJ-GNSKQFMSNA-N |
InChICode |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h7,10,19-20,23-27,30H,8-9,11-18H2,1-6H3/b21-7+/t20-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@@H](CC/C(=C\C)/C(C)C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Dendrophylliidae | Turbinaria conoides | Ref. |
Chromalveolata | Dictyotaceae | Dictyopteris divaricata | Ref. |
Chromalveolata | Dictyotaceae | Spatoglossum variabile | Ref. |
Chromalveolata | Leptomitaceae | Apodachlya brachynema | Ref. |
Chromalveolata | Leptomitaceae | Apodachlya minima | Ref. |
Chromalveolata | Saprolegniaceae | Aplanopsis terrestris | Ref. |
Chromalveolata | Saprolegniaceae | Saprolegnia ferax | Ref. |
Chromalveolata | Saprolegniaceae | Saprolegnia megasperma | Ref. |
Fungi | Apodachlyellaceae | Apodachlyella completa | Ref. |
Fungi | Saprolegniaceae | Achyla bisexualis | Ref. |
Plantae | Asphodelaceae | Asphodelus albus | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Fucaceae | Fucus vesiculosus | Ref. |
Plantae | Laminariaceae | Laminaria japonica | Ref. |
Plantae | Orchidaceae | Sarcophyton crassocaule | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
- | - | Dictyota dichotoma (Huds.) | Ref. |
- | - | Furcellaria fastigiata | Ref. |
- | - | Leptolegnia caudata | Ref. |
- | - | Patinopecten yessoensis | Ref. |
- | - | Pythiopsis cymosa | Ref. |
|
|
zoom in
Organism | Leptolegnia caudata | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Seitz,J.Agric.Food Chem.,25,(1977),838-841
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function |
---|
|