Name |
Cycloartenol |
Formula |
C30H50O |
Mw |
426.38616622 |
CAS RN |
469-38-5 |
C_ID |
C00003650
,
|
InChIKey |
ONQRKEUAIJMULO-NWHDAKSQNA-N |
InChICode |
InChI=1S/C30H50O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,21-25,31H,8,10-19H2,1-7H3/t21-,22-,23-,24+,25+,27-,28+,29-,30+/m1/s1 |
SMILES |
C1[C@@H](C([C@@H]2[C@]3(C1)[C@]1([C@@H](CC2)[C@]2([C@](CC1)([C@H](CC2)[C@@H](CCC=C(C)C)C)C)C)C3)(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Araliaceae | Panax ginseng | Ref. |
Plantae | Asparagaceae | Asparagus racemosus | Ref. |
Plantae | Asteraceae | Santolina rosmarinifolia subsp. canescens | Ref. |
Plantae | Betulaceae | Betula platyphylla | Ref. |
Plantae | Burseraceae | Commiphora wightii | Ref. |
Plantae | Chlamydomonadaceae | Chlamydomonas reinhardtii | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Costaceae | Costus speciosus | Ref. |
Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cucurbitaceae | Cucurbita pepo | Ref. |
Plantae | Cucurbitaceae | Luffa cylindrica | Ref. |
Plantae | Cucurbitaceae | Momordica charantia | Ref. |
Plantae | Dioscoreaceae | Dioscorea zingiberensis | Ref. |
Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
Plantae | Euphorbiaceae | Euphorbia lathyris | Ref. |
Plantae | Euphorbiaceae | Euphorbia neriifolia | Ref. |
Plantae | Euphorbiaceae | Euphorbia peplus | Ref. |
Plantae | Euphorbiaceae | Euphorbia petiolata | Ref. |
Plantae | Euphorbiaceae | Euphorbia segetalis | Ref. |
Plantae | Euphorbiaceae | Pedilanthus tithymaloides | Ref. |
Plantae | Euphorbiaceae | Ricinus communis | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
Plantae | Fabaceae | Lotus japonicus | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago truncatula | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Gentianaceae | Gentiana straminea | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Linaceae | Linum usitatissimum | Ref. |
Plantae | Meliaceae | Swietenia mahogani | Ref. |
Plantae | Moraceae | Artocarpus integrifolia | Ref. |
Plantae | Pinaceae | Abies magnifica | Ref. |
Plantae | Plantaginaceae | Digitalis lanata Ehrh. | Ref. |
Plantae | Poaceae | Avena strigosa | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Pteridaceae | Adiantum capillus-veneris | Ref. |
Plantae | Ranunculaceae | Nigella sativa | Ref. |
Plantae | Rhizophoraceae | Kandelia candel | Ref. |
Plantae | Rhizophoraceae | Rhizophora stylosa | Ref. |
Plantae | Salicaceae | Populus tremula L. | Ref. |
Plantae | Samydaceae | Casearia ilicifolia | Ref. |
Plantae | Santalaceae | Santalum album | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
- | - | Polypodiodes niponica | Ref. |
|
|
zoom in
Organism | Commiphora wightii | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|