Name |
Campesterol 24alpha-Methylcholesterol (24R)24-Methylcholest-5-en-3beta-ol |
Formula |
C28H48O |
Mw |
400.37051615 |
CAS RN |
474-62-4 |
C_ID |
C00003647
,
|
InChIKey |
SGNBVLSWZMBQTH-RWVZYBNDNA-N |
InChICode |
InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18-20,22-26,29H,7-8,10-17H2,1-6H3/t19-,20-,22+,23+,24-,25+,26+,27+,28-/m1/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@@H](CC[C@H](C(C)C)C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
Fungi | Acaulosporaceae | Acaulospora laevis | Ref. |
Fungi | Blastocladiaceae | Allomyces macrogynus | Ref. |
Fungi | Glomeraceae | Glomus mosseae | Ref. |
Fungi | Nectriaceae | Fusarium sporotrichioides | Ref. |
Plantae | Acanthaceae | Ruellia tuberosa | Ref. |
Plantae | Adoxaceae | Sambucus canadensis | Ref. |
Plantae | Adoxaceae | Sambucus nigra | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Amaranthaceae | Blutaparon portulacoides | Ref. |
Plantae | Amaranthaceae | Gomphrena celosioides | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Asphodelaceae | Aloe barbadensis | Ref. |
Plantae | Asphodelaceae | Asphodelus albus | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Senecio viravira | Ref. |
Plantae | Asteraceae | Xanthium strumarium | Ref. |
Plantae | Betulaceae | Corylus avellana | Ref. |
Plantae | Betulaceae | Corylus maxima | Ref. |
Plantae | Boraginaceae | Heliotropium indicum | Ref. |
Plantae | Clusiaceae | Pentaphalangium solomonse Warb. | Ref. |
Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica campestris L. | Ref. |
Plantae | Cruciferae | Brassica napa | Ref. |
Plantae | Cruciferae | Brassica napus | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Brassica rapa L. | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cruciferae | Erysimum carniolicum | Ref. |
Plantae | Cucurbitaceae | Cucurbita sp. | Ref. |
Plantae | Cucurbitaceae | Trichosanthes kirilowii | Ref. |
Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
Plantae | Dioscoreaceae | Dioscorea cyphocarpa | Ref. |
Plantae | Dioscoreaceae | Tamus communis L. | Ref. |
Plantae | Ebenaceae | Diospyros kaki | Ref. |
Plantae | Euphorbiaceae | Aleurites fordii Hemsl. | Ref. |
Plantae | Euphorbiaceae | Croton urucurana Baill. | Ref. |
Plantae | Euphorbiaceae | Euphorbia indica | Ref. |
Plantae | Euphorbiaceae | Euphorbia lathyris | Ref. |
Plantae | Fabaceae | Astragalus glycyphyllos | Ref. |
Plantae | Fabaceae | Bauhinia candicans | Ref. |
Plantae | Fabaceae | Bauhinia vahlii L. | Ref. |
Plantae | Fabaceae | Erythrina arborescens Roxb. | Ref. |
Plantae | Fabaceae | Glycine ma | Ref. |
Plantae | Fabaceae | Glycine max | Ref. |
Plantae | Fabaceae | Lupinus albus | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Pisum sativum | Ref. |
Plantae | Fabaceae | Prosopis spicigera | Ref. |
Plantae | Gentianaceae | Gentiana lutea L. | Ref. |
Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
Plantae | Hydrocharitaceae | Halophila ovalis | Ref. |
Plantae | Hydrocharitaceae | Halophila ovata | Ref. |
Plantae | Hydrocharitaceae | Halophila spinulosa | Ref. |
Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
Plantae | Hypericaceae | Hypericum carinatum | Ref. |
Plantae | Jubulaceae | Frullania monocera | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Scutellaria baicalensis | Ref. |
Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
Plantae | Labiatae | Sideritis discolor | Ref. |
Plantae | Labiatae | Sideritis kuegleriana | Ref. |
Plantae | Labiatae | Sideritis lotsyi | Ref. |
Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
Plantae | Labiatae | Sideritis soluta | Ref. |
Plantae | Labiatae | Sideritis tenoi | Ref. |
Plantae | Lauraceae | Litsea japonica | Ref. |
Plantae | Lauraceae | Neolitsea aciculata | Ref. |
Plantae | Longaniaceae | Strychnos dolychothyrsa | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Malvaceae | Malva parviflora | Ref. |
Plantae | Malvaceae | Sida rhombifolia | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Meliaceae | Khaya ivorensis | Ref. |
Plantae | Meliaceae | Khaya senegalensis L. | Ref. |
Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
Plantae | Orchidaceae | Sarcophyton crassocaule | Ref. |
Plantae | Oxalidaceae | Averrhoa carambola | Ref. |
Plantae | Palmae | Cocos nucifera | Ref. |
Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
Plantae | Plantaginaceae | Digitalis lanata Ehrh. | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Poaceae | Oryza sativa | Ref. |
Plantae | Poaceae | Triticum spp | Ref. |
Plantae | Poaceae | Triticum spp. | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Rubiaceae | Paederia foetida | Ref. |
Plantae | Ruppiaceae | Ruppia maritima | Ref. |
Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
Plantae | Sapindaceae | Schleichera trijuga | Ref. |
Plantae | Solanaceae | Nicotiana benthamiana | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum chacoense Bitt. | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Solanaceae | Solanum xanthocarpum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus cuspidata | Ref. |
Plantae | Urticaceae | Boehmeria holosericea | Ref. |
Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
- | - | Caffea sp. | Ref. |
- | - | Chorisia insignis | Ref. |
- | - | Chorisia speciosa | Ref. |
- | - | Crotone hieronymi | Ref. |
- | - | Hyphochytrium catenoides | Ref. |
- | - | Libanotis intermedia | Ref. |
- | - | Monoblepharella sp. | Ref. |
- | - | Placopecten magellanicus | Ref. |
- | - | Rhizidiomyces apophysatus | Ref. |
- | - | Spizellomyces punctatum | Ref. |
- | - | Strachybotrys alternans | Ref. |
|
|
zoom in
Organism | Placopecten magellanicus | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,3,(1992),3,567B |
---|
|