Name |
Brassicasterol (24R)24-Methylcholest-5,22-dien-3beta-ol |
Formula |
C28H46O |
Mw |
398.35486609 |
CAS RN |
474-67-9 |
C_ID |
C00003646
,
|
InChIKey |
OILXMJHPFNGGTO-QHFAAILRNA-N |
InChICode |
InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20-,22-,23-,24+,25-,26-,27-,28-/m0/s1 |
SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@@]1([C@H]3CC[C@@H]1[C@H](/C=C/[C@@H](C(C)C)C)C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Arthrodermataceae | Trichophyton rubrum | Ref. |
Fungi | Cladoniaceae | Cladonia gonecha | Ref. |
Fungi | Clavicipitaceae | Claviceps fusiformis | Ref. |
Fungi | Clavicipitaceae | Claviceps purpurea | Ref. |
Fungi | Gnomoniaceae | Gnomonia leptostyla | Ref. |
Fungi | Protomycetaceae | Protomyces sp. | Ref. |
Fungi | Stereocaulaceae | Stereocaulon tomentosum | Ref. |
Fungi | Taphrinaceae | Taphrina sp. | Ref. |
Fungi | Terfeziaceae/Pezizaceae | Terfezia sp. | Ref. |
Fungi | Trichocomaceae | Aspergillus oryzae | Ref. |
Plantae | Alliaceae | Allium obliquum | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Brassica napus | Ref. |
Plantae | Cruciferae | Brassica oleracea | Ref. |
Plantae | Cruciferae | Brassica rapa L. | Ref. |
Plantae | Plantaginaceae | Veronica officinalis | Ref. |
Plantae | Plantaginaceae | Veronica orchidea | Ref. |
Plantae | Plantaginaceae | Veronica teucrium | Ref. |
Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
Plantae | Sapindaceae | Schleichera trijuga | Ref. |
- | - | Chloromorum toxicum | Ref. |
- | - | Chorisia insignis | Ref. |
- | - | Chorisia speciosa | Ref. |
- | - | Genera protomyces | Ref. |
- | - | Tuber bramale | Ref. |
|
|
zoom in
Organism | Claviceps purpurea | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983) |
---|
|