Name |
Gossypol |
Formula |
C30H30O8 |
Mw |
518.19406794 |
CAS RN |
303-45-7 |
C_ID |
C00003136
,
|
InChIKey |
QBKSWRVVCFFDOT-UHFFFAOYSA-N |
InChICode |
InChI=1S/C30H30O8/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36/h7-12,33-38H,1-6H3 |
SMILES |
Cc1cc2c(C(C)C)c(O)c(O)c(C=O)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=O)c2c1O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Fungi | Plectosphaerellaceae | Verticillium albo-atrum | Ref. |
Plantae | Bombacaceae | Montezuma speciosissima | Ref. |
Plantae | Combretaceae | Calycopteris floribunda | Ref. |
Plantae | Malvaceae | Gossypium barbadense | Ref. |
Plantae | Malvaceae | Gossypium herbaceum | Ref. |
Plantae | Malvaceae | Gossypium hirsutum | Ref. |
Plantae | Malvaceae | Gossypium mexicanum | Ref. |
Plantae | Malvaceae | Gossypium sp. | Ref. |
Plantae | Malvaceae | Sida rhombifolia | Ref. |
Plantae | Malvaceae | Thespesia populnea | Ref. |
Plantae | Rosaceae | Kerria japonica | Ref. |
|
|
zoom in
Organism | Sida rhombifolia | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|