Name |
beta-Caryophyllene (E)-beta-Caryophyllene caryophyllene Caryophyllene (E)-Caryophyllene (-)-(E)-Caryophyllene trans-Caryophyllene trans-beta-Caryophyllene |
Formula |
C15H24 |
Mw |
204.18780077 |
CAS RN |
87-44-5 |
C_ID |
C00003110
,
|
InChIKey |
NPNUFJAVOOONJE-UNCLKFFANA-N |
InChICode |
InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-/m1/s1 |
SMILES |
C1C(=C)[C@@H]2[C@@H](CC/C(=C/C1)/C)C(C2)(C)C |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
Fungi | Davidiellaceae | Cladosporium cladosporioides | Ref. |
Plantae | Acanthaceae | Strobilanthes ixiocephala | Ref. |
Plantae | Acoraceae | Acorus calamus | Ref. |
Plantae | Anacardiaceae | Anacardium occidentale | Ref. |
Plantae | Anacardiaceae | Mangifera indica | Ref. |
Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
Plantae | Annonaceae | Annona glabra | Ref. |
Plantae | Annonaceae | Annona muricata | Ref. |
Plantae | Annonaceae | Annona squamosa | Ref. |
Plantae | Annonaceae | Cananga odorata | Ref. |
Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
Plantae | Annonaceae | Monodora myristica | Ref. |
Plantae | Annonaceae | Xylopia aethiopica | Ref. |
Plantae | Annonaceae | Xylopia frutescens | Ref. |
Plantae | Annonaceae | Xylopia parviflora | Ref. |
Plantae | Annonaceae | Xylopia rubescens | Ref. |
Plantae | Annonaceae | Xylopia sericea | Ref. |
Plantae | Apiaceae | Apium graveolens | Ref. |
Plantae | Apiaceae | Cuminum cyminum L. | Ref. |
Plantae | Apiaceae | Daucus carota | Ref. |
Plantae | Apiaceae | Foeniculum vulgare | Ref. |
Plantae | Apiaceae | Petroselinum crispum | Ref. |
Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
Plantae | Araliaceae | Centella asiatica | Ref. |
Plantae | Aristolochiaceae | Aristolochia trilobata | Ref. |
Plantae | Asteraceae | Ageratina conyzoides | Ref. |
Plantae | Asteraceae | Ageratina jocotepecana | Ref. |
Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
Plantae | Asteraceae | Ambrosia trifida | Ref. |
Plantae | Asteraceae | Artemisia anethoides | Ref. |
Plantae | Asteraceae | Artemisia annua | Ref. |
Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti | Ref. |
Plantae | Asteraceae | Artemisia spp. | Ref. |
Plantae | Asteraceae | Carthamus tinctorius | Ref. |
Plantae | Asteraceae | Centaurea armena | Ref. |
Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
Plantae | Asteraceae | Centaurea orientalis | Ref. |
Plantae | Asteraceae | Centaurea sessilis | Ref. |
Plantae | Asteraceae | Chamaemelum nobile | Ref. |
Plantae | Asteraceae | Chamomilla recutina | Ref. |
Plantae | Asteraceae | Cyathocline purpurea | Ref. |
Plantae | Asteraceae | Dittrichia graveolens | Ref. |
Plantae | Asteraceae | Eupatorium adenophorum | Ref. |
Plantae | Asteraceae | Helianthus annuus | Ref. |
Plantae | Asteraceae | Matricaria chamomilla | Ref. |
Plantae | Asteraceae | Matricaria domestica | Ref. |
Plantae | Asteraceae | Matricaria micrantha | Ref. |
Plantae | Asteraceae | Matricaria recutita | Ref. |
Plantae | Asteraceae | Petasites albus | Ref. |
Plantae | Asteraceae | Petasites hybridus | Ref. |
Plantae | Asteraceae | Phagnalon sordidum | Ref. |
Plantae | Asteraceae | Pteronia eenii | Ref. |
Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
Plantae | Asteraceae | Senecio vulgaris | Ref. |
Plantae | Asteraceae | Serratula wolfi | Ref. |
Plantae | Asteraceae | Solidago canadensis | Ref. |
Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
Plantae | Asteraceae | Trichogonia grazielae | Ref. |
Plantae | Burseraceae | Commiphora holtziana | Ref. |
Plantae | Canellaceae | Canella winterana | Ref. |
Plantae | Canellaceae | Pleodendron costaricense | Ref. |
Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
Plantae | Cannabaceae | Humulus lupulus | Ref. |
Plantae | Caricaceae | Carica papaya | Ref. |
Plantae | Caryophyllaceae | Dianthus caryophyllus L. | Ref. |
Plantae | Cistaceae | Cistus albidus | Ref. |
Plantae | Cistaceae | Cistus creticus | Ref. |
Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
Plantae | Crassulaceae | Rhodiola rosea L. | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Capsella bursa-pastoris | Ref. |
Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
Plantae | Cupressaceae | Juniperus spp. | Ref. |
Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
Plantae | Cyperaceae | Cyperus rotundus L. | Ref. |
Plantae | Fabaceae | Copaifera spp. | Ref. |
Plantae | Fabaceae | Medicago sativa | Ref. |
Plantae | Fabaceae | Rhynchosia minima | Ref. |
Plantae | Fabaceae | Tipuana tipu | Ref. |
Plantae | Fabaceae | Trifolium repens L. | Ref. |
Plantae | Fagaceae | Quercus coccifera | Ref. |
Plantae | Illiciaceae | Illicium anisatum | Ref. |
Plantae | Jubulaceae | Frullania aterrima var. aterrima | Ref. |
Plantae | Jubulaceae | Frullania falciloba | Ref. |
Plantae | Jubulaceae | Frullania monocera | Ref. |
Plantae | Jubulaceae | Frullania probosciphora | Ref. |
Plantae | Jubulaceae | Frullania pycnantha | Ref. |
Plantae | Jubulaceae | Frullania spinifera | Ref. |
Plantae | Labiatae | Caryopteris spp. | Ref. |
Plantae | Labiatae | Clinopodium nepeta | Ref. |
Plantae | Labiatae | Lavandula angustifolia | Ref. |
Plantae | Labiatae | Lavandula bipinnata | Ref. |
Plantae | Labiatae | Lavandula canarien-sis | Ref. |
Plantae | Labiatae | Lavandula dentata | Ref. |
Plantae | Labiatae | Lavandula gibsoni | Ref. |
Plantae | Labiatae | Lavandula multifida | Ref. |
Plantae | Labiatae | Lavandula spp. | Ref. |
Plantae | Labiatae | Melissa officinalis | Ref. |
Plantae | Labiatae | Mentha arvensis L. | Ref. |
Plantae | Labiatae | Mentha piperita L. | Ref. |
Plantae | Labiatae | Mentha pulegium L. | Ref. |
Plantae | Labiatae | Mentha spp. | Ref. |
Plantae | Labiatae | Ocimum americanum | Ref. |
Plantae | Labiatae | Ocimum basilicum | Ref. |
Plantae | Labiatae | Ocimum gratissimum | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicum | Ref. |
Plantae | Labiatae | Ocimum tenuiflorum | Ref. |
Plantae | Labiatae | Origanum vulgare | Ref. |
Plantae | Labiatae | Perilla frutescens | Ref. |
Plantae | Labiatae | Perilla ocimoides | Ref. |
Plantae | Labiatae | Pogostemon cablin | Ref. |
Plantae | Labiatae | Rosmarinus officinalis | Ref. |
Plantae | Labiatae | Salvia canariensis L. | Ref. |
Plantae | Labiatae | Salvia officinalis | Ref. |
Plantae | Labiatae | Salvia spp. | Ref. |
Plantae | Labiatae | Satureja subspicata | Ref. |
Plantae | Labiatae | Thymus broussonetti | Ref. |
Plantae | Labiatae | Thymus capitatus | Ref. |
Plantae | Labiatae | Thymus maroccanus | Ref. |
Plantae | Labiatae | Thymus piperella | Ref. |
Plantae | Labiatae | Thymus praecos | Ref. |
Plantae | Labiatae | Thymus spp. | Ref. |
Plantae | Labiatae | Thymus vulgaris | Ref. |
Plantae | Labiatae | Trichostema lanceolatum | Ref. |
Plantae | Labiatae | Vitex negundo | Ref. |
Plantae | Lamiaceae | Calamintha nepeta | Ref. |
Plantae | Lamiaceae | Coleus aromaticus | Ref. |
Plantae | Lauraceae | Cinnamomum camphora | Ref. |
Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
Plantae | Lauraceae | Cinnamomum spp. | Ref. |
Plantae | Lauraceae | Cinnamomum zeylanicum | Ref. |
Plantae | Lauraceae | Laurus nobilis | Ref. |
Plantae | Lauraceae | Litsea cubeba | Ref. |
Plantae | Lauraceae | Litsea zeylanica | Ref. |
Plantae | Lauraceae | Ocotea meziana | Ref. |
Plantae | Lauraceae | Ocotea sinuata | Ref. |
Plantae | Lauraceae | Ocotea whitei | Ref. |
Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
Plantae | Lythraceae | Punica granatum | Ref. |
Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
Plantae | Malvaceae | Abutilon indicum | Ref. |
Plantae | Meliaceae | Azadirachta indica | Ref. |
Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
Plantae | Myrtaceae | Acca sellowiana | Ref. |
Plantae | Myrtaceae | Eucalyptus spp. | Ref. |
Plantae | Myrtaceae | Eugenia caryophyllata | Ref. |
Plantae | Myrtaceae | Eugenia zuchowskiae | Ref. |
Plantae | Myrtaceae | Leptospermum scoparium | Ref. |
Plantae | Myrtaceae | Melaleuca leucadendra L. | Ref. |
Plantae | Myrtaceae | Myrtus communis | Ref. |
Plantae | Myrtaceae | Psidium guajava | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Onagraceae | Clarkia sativus | Ref. |
Plantae | Pinaceae | Cedrus libani | Ref. |
Plantae | Pinaceae | Pinus eldarica | Ref. |
Plantae | Pinaceae | Pinus halepensis | Ref. |
Plantae | Pinaceae | Pinus kochiana | Ref. |
Plantae | Pinaceae | Pinus mugo subsp. Mugo | Ref. |
Plantae | Pinaceae | Pinus pallasiana | Ref. |
Plantae | Pinaceae | Pinus sibirica | Ref. |
Plantae | Pinaceae | Pinus sosnowskyi | Ref. |
Plantae | Pinaceae | Pinus spp. | Ref. |
Plantae | Pinaceae | Pinus sylvestris L.var.sylvestris. | Ref. |
Plantae | Pinaceae | Pinus taeda | Ref. |
Plantae | Piperaceae | Piper arboreum | Ref. |
Plantae | Piperaceae | Piper nigrum | Ref. |
Plantae | Plantaginaceae | Veronica spicata | Ref. |
Plantae | Poaceae | Capillipedium parviflorum | Ref. |
Plantae | Poaceae | Phyllostachys dulcis | Ref. |
Plantae | Poaceae | Zea mays | Ref. |
Plantae | Polygonaceae | Polygonum minus | Ref. |
Plantae | Primulaceae | Primula halleri | Ref. |
Plantae | Ptilidiaceae | Ptilidium ciliare | Ref. |
Plantae | Rutaceae | Atalantia guillauminii | Ref. |
Plantae | Rutaceae | Citrus aurantifolia | Ref. |
Plantae | Rutaceae | Citrus aurantium | Ref. |
Plantae | Rutaceae | Citrus grandis | Ref. |
Plantae | Rutaceae | Citrus hystrix | Ref. |
Plantae | Rutaceae | Citrus latifolia | Ref. |
Plantae | Rutaceae | Citrus limon | Ref. |
Plantae | Rutaceae | Citrus medica | Ref. |
Plantae | Rutaceae | Citrus paradise x Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Citrus paradisi | Ref. |
Plantae | Rutaceae | Citrus reticulata | Ref. |
Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sinensis | Ref. |
Plantae | Rutaceae | Citrus sinki x Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Citrus spp. | Ref. |
Plantae | Rutaceae | Clausena excavata | Ref. |
Plantae | Rutaceae | Fortunella margarita | Ref. |
Plantae | Rutaceae | Murraya exotica | Ref. |
Plantae | Rutaceae | Murraya paniculata | Ref. |
Plantae | Rutaceae | Phellodendron amurense | Ref. |
Plantae | Rutaceae | Poncirus trifoliata | Ref. |
Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
Plantae | Rutaceae | Zanthoxylum armatum | Ref. |
Plantae | Saururaceae | Houttuynia cordata | Ref. |
Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
Plantae | Scapaniaceae | Scapania undulata | Ref. |
Plantae | Solanaceae | Mandragora autumnalis | Ref. |
Plantae | Solanaceae | Nicotiana alata | Ref. |
Plantae | Solanaceae | Nicotiana cavicola | Ref. |
Plantae | Solanaceae | Nicotiana ingulba | Ref. |
Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
Plantae | Solanaceae | Nicotiana mutabilis | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Solanum lycopersicum | Ref. |
Plantae | Solanaceae | Solanum tuberosum | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Taxaceae | Taxus wallichiana | Ref. |
Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
Plantae | Theaceae | Camellia sinensis | Ref. |
Plantae | Turneraceae | Turnera diffusa | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansi | Ref. |
Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
Plantae | Verbenaceae | Lantana camara L. | Ref. |
Plantae | Verbenaceae | Lippia angustifolia | Ref. |
Plantae | Vitaceae | Vitis vinifera | Ref. |
Plantae | Zingiberaceae | Aframomum melegueta | Ref. |
Plantae | Zingiberaceae | Curcuma aeruginosa | Ref. |
Plantae | Zingiberaceae | Curcuma amada | Ref. |
Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
Plantae | Zingiberaceae | Curcuma aromatica | Ref. |
Plantae | Zingiberaceae | Curcuma kwangsiensis | Ref. |
Plantae | Zingiberaceae | Curcuma longa | Ref. |
Plantae | Zingiberaceae | Curcuma mangga | Ref. |
Plantae | Zingiberaceae | Curcuma phaeocaulis | Ref. |
Plantae | Zingiberaceae | Curcuma wenyujin | Ref. |
Plantae | Zingiberaceae | Curcuma xanthorrhiza | Ref. |
Plantae | Zingiberaceae | Curcuma zedoria | Ref. |
Plantae | Zingiberaceae | Zingiber cassumunar Roxb. | Ref. |
Plantae | Zingiberaceae | Zingiber officinale | Ref. |
- | - | Alphinia galanga | Ref. |
- | - | Baeckea frutescens L. | Ref. |
- | - | Gackstroemia magellanica | Ref. |
- | - | Lavandin abrialis | Ref. |
|
|
zoom in
Organism | Origanum vulgare | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
---|
|